![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | uchebnik_arabskogo_jazyka.kuzjmin.pdf | 2023-11-22 11:29 | 16M | |
![[ ]](/icons/layout.gif) | smith_adam_ed_ielts_writing_task_2.pdf | 2023-11-15 10:14 | 553K | |
![[DIR]](/icons/folder.gif) | road to ielts test3/ | 2024-01-03 13:38 | - | |
![[DIR]](/icons/folder.gif) | road to ielts test2/ | 2024-01-03 13:38 | - | |
![[ ]](/icons/layout.gif) | official cambridge ielts10.pdf | 2023-11-13 12:09 | 47M | |
![[DIR]](/icons/folder.gif) | navigate-c1-workbook-CD/ | 2024-01-03 13:30 | - | |
![[DIR]](/icons/folder.gif) | navigate-c1-coursebook-CD/ | 2024-01-03 13:29 | - | |
![[DIR]](/icons/folder.gif) | navigate-b2-workbook-CD/ | 2024-01-03 13:29 | - | |
![[DIR]](/icons/folder.gif) | navigate-b2-coursebook-CD/ | 2024-01-03 13:29 | - | |
![[DIR]](/icons/folder.gif) | navigate-b1plus-workbook-CD/ | 2024-01-03 13:28 | - | |
![[DIR]](/icons/folder.gif) | navigate-b1plus-coursebook-CD/ | 2024-01-03 13:28 | - | |
![[DIR]](/icons/folder.gif) | navigate-b1-workbook-CD/ | 2024-01-03 13:27 | - | |
![[DIR]](/icons/folder.gif) | navigate-b1-coursebook-CD/ | 2024-01-03 13:27 | - | |
![[DIR]](/icons/folder.gif) | navigate-a2-workbook-audio/ | 2024-01-03 13:27 | - | |
![[DIR]](/icons/folder.gif) | navigate-a2-coursebook-audio/ | 2024-01-03 13:26 | - | |
![[DIR]](/icons/folder.gif) | navigate-a1-coursebook-CD&WB/ | 2024-01-03 13:25 | - | |
![[ ]](/icons/layout.gif) | multi-level-reading-test.pdf | 2023-11-30 15:46 | 1.6M | |
![[ ]](/icons/layout.gif) | hsk-1-word-list-(my-hsk.com).pdf | 2023-11-09 15:38 | 785K | |
![[DIR]](/icons/folder.gif) | headway_pre_intermediate_student_s_book_audio/ | 2024-01-03 13:12 | - | |
![[DIR]](/icons/folder.gif) | headway_elementary_student_s_book_audio.part1/ | 2024-01-03 13:11 | - | |
![[ ]](/icons/layout.gif) | familyvocabularylist.pdf | 2023-11-15 10:11 | 229K | |
![[ ]](/icons/layout.gif) | essential_tests_for_ielts.pdf | 2023-11-28 17:30 | 43M | |
![[ ]](/icons/layout.gif) | english-file-a2-b1-student-book-4th-edition.pdf | 2023-11-15 10:16 | 56M | |
![[ ]](/icons/layout.gif) | elsthrough-reading.pdf | 2023-11-28 17:25 | 3.4M | |
![[DIR]](/icons/folder.gif) | effective_academic_writing_students_book_2_the_short_essay_a/ | 2024-01-03 12:51 | - | |
![[DIR]](/icons/folder.gif) | effective_academic_writing_students_book_1_the_paragraph_ans/ | 2024-01-03 12:51 | - | |
![[ ]](/icons/layout.gif) | ef-epi-2021-russian.pdf | 2023-10-27 17:12 | 4.2M | |
![[ ]](/icons/layout.gif) | destination-b2.pdf | 2023-11-13 12:08 | 29M | |
![[ ]](/icons/layout.gif) | complete_ielts_bands_4_5_sb.pdf | 2023-11-13 12:08 | 91M | |
![[ ]](/icons/layout.gif) | cambridge_ielts_15.pdf | 2023-11-06 16:16 | 28M | |
![[DIR]](/icons/folder.gif) | book for beginners/ | 2024-01-03 12:41 | - | |
![[ ]](/icons/layout.gif) | beginner_elementary_placement_test.pdf | 2023-11-13 14:33 | 201K | |
![[ ]](/icons/layout.gif) | arab tili darslik.pdf | 2023-11-13 15:18 | 2.6M | |
![[ ]](/icons/layout.gif) | arab hatotligi.pdf | 2023-03-30 16:25 | 33M | |
![[ ]](/icons/layout.gif) | arab_tili_qiyosiy_grammatikasi.pdf | 2023-11-27 14:45 | 1.1M | |
![[ ]](/icons/layout.gif) | adefoged peter johnson keith a course in phonetics.pdf | 2023-10-26 16:53 | 9.3M | |
![[ ]](/icons/layout.gif) | academic writing a handbook for international. Bailey Stephen.pdf | 2023-10-26 16:16 | 1.0M | |
![[ ]](/icons/layout.gif) | academic_writing_a_handbook_for_international_Bailey_Stephen.pdf | 2023-11-22 15:36 | 1.0M | |
![[ ]](/icons/layout.gif) | Zamonaviy_arab_adabiyoti_o'zbek_adabiyotshunoslari_talqinida.pdf | 2023-10-30 16:46 | 28M | |
![[ ]](/icons/layout.gif) | YouNine_ebook_writing.pdf | 2023-11-13 15:17 | 356K | |
![[ ]](/icons/layout.gif) | Yangi amaliy Xitoy tili darsligi.pdf | 2023-10-31 16:03 | 39M | |
![[ ]](/icons/layout.gif) | Xitoy tili.pdf | 2023-11-06 16:55 | 3.9M | |
![[ ]](/icons/layout.gif) | Xitoy_tili_kursi_1-1乌语版汉语教程.pdf | 2023-11-07 10:54 | 6.3M | |
![[ ]](/icons/layout.gif) | Xitoy_tili_grammatik_terminologiyasi_shakllanishi_va_taraqqiyoti.pdf | 2023-11-07 10:51 | 926K | |
![[ ]](/icons/layout.gif) | Xitoy_adabiyoti_tarixi_janrlar_tipologiyasi_J_Ziyamuhamedov,_O_Ochilov.pdf | 2023-10-31 11:44 | 61M | |
![[ ]](/icons/layout.gif) | Writing task 1-1_1.pdf | 2023-11-15 10:14 | 3.8M | |
![[ ]](/icons/layout.gif) | Writing for Both Tasks and Speaking Questions .pdf | 2023-11-29 14:08 | 333K | |
![[ ]](/icons/layout.gif) | Writing for Both Tasks and Speaking Questions (1).pdf | 2023-11-29 14:09 | 333K | |
![[ ]](/icons/layout.gif) | Writing and Speaking Questions for Mock test .pdf | 2023-11-29 14:09 | 421K | |
![[ ]](/icons/layout.gif) | Writing_task_two_course_pack.pdf | 2023-11-29 15:51 | 4.1M | |
![[ ]](/icons/layout.gif) | Writing_task_one_course_pack.pdf | 2023-11-29 15:51 | 3.5M | |
![[ ]](/icons/layout.gif) | Writing_answer_sheet.pdf | 2023-11-28 17:23 | 73K | |
![[ ]](/icons/layout.gif) | Writing_Topics_and_Questions_for_CEFR_Multilevel_Test_by_Kamoliddin.pdf | 2023-11-30 15:48 | 6.4M | |
![[ ]](/icons/layout.gif) | Writing_Structure_for_IELTS_students_Discuss_both_views_and_give.pdf | 2023-11-29 14:09 | 77K | |
![[ ]](/icons/layout.gif) | Writing Task 2 sample answers by examiners.pdf | 2023-11-30 15:46 | 917K | |
![[ ]](/icons/layout.gif) | Writing Task 2 sample answers by examiners (1).pdf | 2023-11-30 15:46 | 917K | |
![[ ]](/icons/layout.gif) | Writing Task 1.pdf | 2023-11-30 15:47 | 2.8M | |
![[ ]](/icons/layout.gif) | Writing Collocations for IELTS.pdf | 2023-11-30 15:47 | 300K | |
![[ ]](/icons/layout.gif) | Writing 2021 Task 2 Questions.pdf | 2023-11-29 15:51 | 223K | |
![[ ]](/icons/layout.gif) | Write better essays.pdf | 2023-11-20 12:09 | 1.1M | |
![[ ]](/icons/layout.gif) | Workbook 1B. Korean book.pdf | 2023-11-02 11:21 | 50M | |
![[DIR]](/icons/folder.gif) | Work_on_Your_Accent_Audio&Book/ | 2024-01-03 13:48 | - | |
![[ ]](/icons/layout.gif) | Words_That_Change_Minds_The_14_Patterns_for_Mastering_the_Language.pdf | 2023-10-30 11:56 | 6.6M | |
![[ ]](/icons/layout.gif) | Wordnik Grammar for IELTS Writing.pdf | 2023-11-30 16:53 | 478K | |
![[ ]](/icons/layout.gif) | Word Patterns.pdf | 2023-11-29 14:09 | 69K | |
![[ ]](/icons/layout.gif) | Word List for Level C1 .pdf | 2023-11-29 15:56 | 1.7M | |
![[ ]](/icons/layout.gif) | Who will cry when you die (11).pdf | 2023-11-15 10:13 | 643K | |
![[ ]](/icons/layout.gif) | Who will cry when you die (10).pdf | 2023-11-15 10:17 | 1.0M | |
![[ ]](/icons/layout.gif) | Who will cry when you die (9).pdf | 2023-11-15 10:19 | 1.1M | |
![[ ]](/icons/layout.gif) | Who will cry when you die (8).pdf | 2023-11-15 10:13 | 1.2M | |
![[ ]](/icons/layout.gif) | Who will cry when you die (7).pdf | 2023-11-15 10:13 | 3.7M | |
![[ ]](/icons/layout.gif) | Who will cry when you die (6).pdf | 2023-11-15 10:17 | 6.5M | |
![[ ]](/icons/layout.gif) | Who will cry when you die (5).pdf | 2023-11-15 10:12 | 147K | |
![[ ]](/icons/layout.gif) | Who will cry when you die (4).pdf | 2023-11-15 10:19 | 215K | |
![[ ]](/icons/layout.gif) | Who will cry when you die (3).pdf | 2023-11-15 10:12 | 274K | |
![[ ]](/icons/layout.gif) | Who will cry when you die (2).pdf | 2023-11-15 09:57 | 301K | |
![[ ]](/icons/unknown.gif) | Vocabulary for IELTS Advanced.PDF | 2023-11-28 17:27 | 21M | |
![[ ]](/icons/layout.gif) | Vocabulary for IELTS 2.pdf | 2023-11-13 12:05 | 57M | |
![[ ]](/icons/layout.gif) | Vocabulary for IELTS.pdf | 2023-11-06 10:17 | 57M | |
![[ ]](/icons/layout.gif) | Vocabulary by Topics.pdf | 2023-11-29 14:09 | 1.4M | |
![[ ]](/icons/layout.gif) | Vocabulary_Files_C1.pdf | 2023-11-29 14:14 | 42M | |
![[ ]](/icons/layout.gif) | Vocabulary Files C2.pdf | 2023-11-30 15:51 | 60M | |
![[ ]](/icons/layout.gif) | Vocabulary Files C1.pdf | 2023-11-30 15:50 | 41M | |
![[ ]](/icons/layout.gif) | Umumiy psixologiya.G‘oziyev E. Darslik.pdf | 2023-10-31 12:52 | 3.7M | |
![[ ]](/icons/layout.gif) | Uchebnik_Po_Chteniyu_3_eng.pdf | 2023-11-07 10:51 | 16M | |
![[ ]](/icons/layout.gif) | Uchebnik_Po_Chteniyu_2_eng.pdf | 2023-11-06 16:18 | 40M | |
![[ ]](/icons/layout.gif) | Turk tilini o‘rganamiz.pdf | 2023-11-21 11:42 | 1.0M | |
![[ ]](/icons/layout.gif) | Turk tilini mustaqil o'rganamiz. Muslim Vosidiy..pdf | 2023-11-13 15:18 | 1.0M | |
![[ ]](/icons/layout.gif) | Turkiy filologiyasi kirish.J.Xudoyberdiyev.pdf | 2023-10-31 11:54 | 9.5M | |
![[ ]](/icons/layout.gif) | Turkcha-o_zbekcha.pdf | 2023-11-21 11:44 | 17M | |
![[ ]](/icons/layout.gif) | Turk_tilining_nazariy_gramatikasi_Z_Xudoyberganova,_X_Hamidov.pdf | 2023-11-13 15:18 | 14M | |
![[ ]](/icons/layout.gif) | Turk_tilini_o‘rganamiz_fayl_11_02_2015_kitob_turkcha_urganamiz.pdf | 2023-11-13 15:18 | 1.0M | |
![[ ]](/icons/layout.gif) | Travel Vocabularies and Phrasel verbs .pdf | 2023-11-29 14:09 | 70K | |
![[ ]](/icons/layout.gif) | Translation+An+advanced+resource+book.pdf | 2023-10-26 16:16 | 6.4M | |
![[ ]](/icons/layout.gif) | Tort Law by Catherine Elliott, Frances Quinn (z-lib.org).pdf | 2023-11-10 11:17 | 5.5M | |
![[ ]](/icons/layout.gif) | Topic FOOD Lesson Notes.pdf | 2023-11-29 15:53 | 961K | |
![[ ]](/icons/layout.gif) | Topic COLOURS Lesson Notes.pdf | 2023-11-29 14:09 | 972K | |
![[ ]](/icons/layout.gif) | Top Tips Reading Answers.pdf | 2023-11-15 10:12 | 25K | |
![[ ]](/icons/layout.gif) | Top Tips Listening Answers.pdf | 2023-11-15 10:12 | 26K | |
![[ ]](/icons/layout.gif) | Top Tips Academic Practice Test.pdf | 2023-11-15 10:12 | 547K | |
![[ ]](/icons/layout.gif) | Top 20 - Great Grammar for Great Writing.pdf | 2023-11-20 12:09 | 9.5M | |
![[ ]](/icons/layout.gif) | Tojiboyeva_Sh_A_Moliyaviy_tahlil_2_Darslik_T_2021.pdf | 2023-11-23 11:50 | 12M | |
![[ ]](/icons/layout.gif) | Time series modelling and forecasting.pdf | 2023-11-29 10:46 | 882K | |
![[ ]](/icons/layout.gif) | Time International Edition - 13-20 February 2023.pdf | 2023-11-29 10:52 | 73M | |
![[ ]](/icons/layout.gif) | Til va adabiyot ma'rifati M.Siddiqov.pdf | 2023-10-31 11:52 | 5.9M | |
![[ ]](/icons/layout.gif) | Tilshunoslik va tabiiy fanlar-B.M.Bahriddinova.pdf | 2023-10-31 11:15 | 8.0M | |
![[ ]](/icons/layout.gif) | Tilshunoslik terminlarining izohli lug`ati.pdf | 2023-11-06 16:07 | 6.8M | |
![[ ]](/icons/layout.gif) | Tilshunoslik nazariyasiga kirish. A.Abduazizov.pdf | 2023-10-31 11:11 | 6.4M | |
![[ ]](/icons/layout.gif) | Tilshunoslik nazariyasi Z.Xolmanova 2020.pdf | 2023-10-31 12:54 | 6.7M | |
![[ ]](/icons/layout.gif) | Tilshunoslik nazariyasi.pdf | 2023-10-30 16:46 | 65M | |
![[ ]](/icons/layout.gif) | Tilshunoslik-asoslari.O'.Sharipova.pdf | 2023-10-31 12:51 | 2.1M | |
![[ ]](/icons/layout.gif) | Til funksional rivojlanishining sotsiolingvistik tahlili.pdf | 2023-10-31 11:54 | 29M | |
![[ ]](/icons/layout.gif) | Til_va_adabiyot_ta'limining_zamonaviy_texnologiyalari_B_To'xliyev.pdf | 2023-10-30 15:10 | 5.5M | |
![[ ]](/icons/layout.gif) | Til_va_adabiyot_Ilmiy_va_amaliy_izlanishlar_yo'lidagi_ilk_odimlar.pdf | 2023-10-31 11:20 | 83M | |
![[ ]](/icons/layout.gif) | Thinking, Fast and Slow by Daniel Kahneman (z-lib.org).pdf | 2023-10-30 10:12 | 3.5M | |
![[ ]](/icons/layout.gif) | The truth about minfulness.pdf | 2023-11-15 10:17 | 1.2M | |
![[ ]](/icons/layout.gif) | The outcomes of Yesterday’s Mock exam .pdf | 2023-11-29 14:09 | 92K | |
![[ ]](/icons/layout.gif) | The outcomes of Yesterday’s Mock exam (1).pdf | 2023-11-29 14:09 | 92K | |
![[ ]](/icons/layout.gif) | The outcomes of Offline Mock test.pdf | 2023-11-29 15:51 | 25K | |
![[ ]](/icons/layout.gif) | The outcomes of Mock Exam.pdf | 2023-11-29 14:09 | 28K | |
![[ ]](/icons/layout.gif) | The key to IELTS writing.pdf | 2023-11-28 17:30 | 52M | |
![[ ]](/icons/layout.gif) | The key to IELTS Writing - Pauline Cullen.pdf | 2023-11-15 09:57 | 44M | |
![[ ]](/icons/layout.gif) | The_simple_action_you_can_take_right.pdf | 2023-11-15 09:55 | 551K | |
![[ ]](/icons/layout.gif) | The_Courage_to_Be_Disliked_by_Ichiro_Kishimi_Fumitake_Koga_z_lib.pdf | 2023-11-06 09:42 | 1.7M | |
![[ ]](/icons/layout.gif) | The_Chid_Learns_to_Read_with_Pictures.pdf | 2023-11-06 16:18 | 13M | |
![[ ]](/icons/layout.gif) | The_Business_Intermediate_Students_Book.pdf | 2023-11-13 09:55 | 63M | |
![[ ]](/icons/layout.gif) | The Rule of Speaking.pdf | 2023-11-29 14:09 | 86K | |
![[ ]](/icons/layout.gif) | The Oxford Dictionary of Difficult Words by Archie Hobson .pdf | 2023-11-29 10:52 | 91M | |
![[DIR]](/icons/folder.gif) | The Official Cambridge Guide to IELTS/ | 2024-01-03 13:45 | - | |
![[ ]](/icons/layout.gif) | The Key to IELTS Writing Success .pdf | 2023-11-13 12:10 | 52M | |
![[ ]](/icons/layout.gif) | The Complete Solution IELTS Writing 2016 .pdf | 2023-11-10 10:06 | 8.9M | |
![[ ]](/icons/layout.gif) | The Complete Solution IELTS Speaking.pdf | 2023-11-29 15:55 | 1.8M | |
![[ ]](/icons/layout.gif) | The Celta course Trainer s manual.pdf | 2023-11-29 14:12 | 28M | |
![[ ]](/icons/layout.gif) | The Best Preparation For IELTS Reading.pdf | 2023-11-28 17:28 | 28M | |
![[ ]](/icons/layout.gif) | The-Key-to-IELTS-Success by Pauline Cullen.pdf | 2023-11-13 12:09 | 17M | |
![[ ]](/icons/layout.gif) | Test master Atalay Oguz.pdf | 2023-11-15 10:20 | 2.2M | |
![[ ]](/icons/layout.gif) | Test_Your_English_Vocabulary_in_Use.pdf | 2023-11-13 15:50 | 5.6M | |
![[ ]](/icons/layout.gif) | Test Your English Vocabulary in Use-Upper Intermediate.pdf | 2023-11-29 10:49 | 7.1M | |
![[ ]](/icons/layout.gif) | Test Your English Vocabulary in Use-Pre & Int.pdf | 2023-11-29 10:48 | 7.5M | |
![[ ]](/icons/layout.gif) | Test Your English Vocabulary in Use-Intermediate.pdf | 2023-11-29 10:47 | 14M | |
![[ ]](/icons/layout.gif) | Test Your English Vocabulary in Use-Elementary.pdf | 2023-11-29 10:50 | 32M | |
![[ ]](/icons/layout.gif) | Test Master.pdf | 2023-11-30 15:46 | 2.2M | |
![[ ]](/icons/layout.gif) | Test 4.pdf | 2023-11-29 15:53 | 863K | |
![[ ]](/icons/layout.gif) | Test 4 (3).pdf | 2023-11-29 15:55 | 3.3M | |
![[ ]](/icons/layout.gif) | Test 4 (2).pdf | 2023-11-29 15:54 | 699K | |
![[ ]](/icons/layout.gif) | Test 3.pdf | 2023-11-29 15:53 | 782K | |
![[ ]](/icons/layout.gif) | Test 3 (4).pdf | 2023-11-29 16:00 | 6.2M | |
![[ ]](/icons/layout.gif) | Test 3 (2).pdf | 2023-11-29 15:55 | 3.4M | |
![[ ]](/icons/layout.gif) | Test 3 (1).pdf | 2023-11-29 15:54 | 728K | |
![[ ]](/icons/layout.gif) | Test 2.pdf | 2023-11-29 15:53 | 810K | |
![[ ]](/icons/layout.gif) | Test 2 (2).pdf | 2023-11-29 15:55 | 3.2M | |
![[ ]](/icons/layout.gif) | Test 2 (1).pdf | 2023-11-29 15:54 | 819K | |
![[ ]](/icons/layout.gif) | Test 1.pdf | 2023-11-29 15:53 | 728K | |
![[ ]](/icons/layout.gif) | Test 1 (5).pdf | 2023-11-29 15:55 | 3.1M | |
![[ ]](/icons/layout.gif) | Test 1 (3).pdf | 2023-11-29 15:55 | 2.9M | |
![[ ]](/icons/layout.gif) | Test 1 (2).pdf | 2023-11-29 15:54 | 850K | |
![[ ]](/icons/layout.gif) | Tedbook compressed.pdf | 2023-11-06 14:59 | 73M | |
![[ ]](/icons/layout.gif) | Teaching & Creativity.pdf | 2023-11-15 10:13 | 50K | |
![[ ]](/icons/layout.gif) | Task 2 Band Descriptors.pdf | 2023-11-15 10:12 | 131K | |
![[ ]](/icons/layout.gif) | Task 1 Band Descriptors.pdf | 2023-11-15 09:57 | 149K | |
![[ ]](/icons/layout.gif) | Task 1 & 2 Band Descriptors.pdf | 2023-11-15 09:54 | 101K | |
![[ ]](/icons/layout.gif) | Tarjimashunoslik muammolari Sh. Sirojiddinov.pdf | 2023-10-30 15:10 | 4.7M | |
![[ ]](/icons/layout.gif) | Tarjima nazariyasi-G.K.Odilova (1).pdf | 2023-10-30 15:10 | 4.7M | |
![[ ]](/icons/layout.gif) | Tarjima amaliyoti-A.M.Bumatova.pdf | 2023-10-30 15:10 | 5.5M | |
![[ ]](/icons/layout.gif) | Tarjima amaliyoti-A.M.Bumatova (1).pdf | 2023-10-30 15:10 | 5.5M | |
![[ ]](/icons/layout.gif) | Talk_Like_TED_The_9_Public_Speaking_Secrets_of_the_Worlds_Top_Minds.pdf | 2023-11-06 09:43 | 1.7M | |
![[ ]](/icons/layout.gif) | TRIO_Writing_3_With_online_practice.pdf | 2023-11-02 11:21 | 20M | |
![[ ]](/icons/layout.gif) | TRIO_Writing_2_With_online_practice.pdf | 2023-11-02 11:21 | 23M | |
![[ ]](/icons/layout.gif) | TRIO_Writing_1_With_online_practice.pdf | 2023-11-02 11:20 | 23M | |
![[ ]](/icons/layout.gif) | TRIO_Reading_3_With_online_practice.pdf | 2023-11-02 11:20 | 22M | |
![[ ]](/icons/layout.gif) | TRIO_Reading_2_With_online_practice.pdf | 2023-11-02 11:20 | 24M | |
![[ ]](/icons/layout.gif) | TRIO_Reading_1_With_online_practice.pdf | 2023-11-02 11:20 | 23M | |
![[ ]](/icons/layout.gif) | TRIO_Listening_and_Speaking_2_With.pdf | 2023-11-02 11:20 | 22M | |
![[ ]](/icons/layout.gif) | TRIO_Listening_and_Speaking_1_With.pdf | 2023-11-02 11:20 | 24M | |
![[ ]](/icons/layout.gif) | TED_Talks_The_Official_TED_Guide_to_Public_Speaking_by_Chris_Anderson.pdf | 2023-11-06 09:43 | 1.9M | |
![[DIR]](/icons/folder.gif) | TEDBOOK/ | 2024-01-03 13:44 | - | |
![[ ]](/icons/layout.gif) | Synonyms for IELTS.pdf | 2023-11-29 15:54 | 53K | |
![[ ]](/icons/layout.gif) | Successful-writing-upper-intermediate.pdf | 2023-11-28 17:27 | 9.1M | |
![[ ]](/icons/layout.gif) | Success Reading Question Type Based.pdf | 2023-11-30 15:47 | 3.3M | |
![[ ]](/icons/layout.gif) | Succeed in IELTS.pdf | 2023-11-29 16:03 | 48M | |
![[ ]](/icons/layout.gif) | Student's book 1B.pdf | 2023-11-02 11:21 | 50M | |
![[ ]](/icons/unknown.gif) | Struktur tilshunoslik ildizlari va yechimlari A. Nurmonov.PDF | 2023-11-01 14:30 | 4.4M | |
![[ ]](/icons/layout.gif) | Stories We Never Tell.pdf | 2023-11-15 09:55 | 1.1M | |
![[ ]](/icons/layout.gif) | Stop Reading The News Rolf Dobelli.pdf | 2023-11-29 10:44 | 2.0M | |
![[ ]](/icons/layout.gif) | Starr, S. Frederick-Lost Enlightenment(2013).pdf | 2023-11-28 17:27 | 31M | |
![[ ]](/icons/layout.gif) | Standards, Assessments and Accountability.pdf | 2023-11-20 11:47 | 232K | |
![[ ]](/icons/layout.gif) | Sports vocabulary list.pdf | 2023-11-15 10:11 | 120K | |
![[ ]](/icons/layout.gif) | Spelling rules Pauline Cullen.pdf | 2023-11-15 10:12 | 52K | |
![[ ]](/icons/layout.gif) | Speakout_intermediate_workbook.pdf | 2023-11-13 09:57 | 69M | |
![[ ]](/icons/layout.gif) | Speakout_2E_intermediate_student_s_book.pdf | 2023-11-13 09:55 | 42M | |
![[ ]](/icons/layout.gif) | Speakout Pre - intermediate Students' Book.pdf | 2023-11-01 15:52 | 139M | |
![[ ]](/icons/layout.gif) | Speakout. Upper-intermediate..pdf | 2023-11-01 15:52 | 134M | |
![[ ]](/icons/layout.gif) | Speakout. Starter Students' Book.pdf | 2023-11-01 15:52 | 121M | |
![[ ]](/icons/layout.gif) | Speakout. Intermediate Students' Book.pdf | 2023-11-01 15:51 | 42M | |
![[ ]](/icons/layout.gif) | Speaking Band Descriptors.pdf | 2023-11-15 10:12 | 161K | |
![[ ]](/icons/layout.gif) | Speaking Band Descriptor.pdf | 2023-11-15 09:54 | 157K | |
![[ ]](/icons/layout.gif) | Speaking-band-descriptors.pdf | 2023-11-15 09:55 | 171K | |
![[ ]](/icons/layout.gif) | Speaking, lesson 2, PDF, Speaking Part 1 worksheet.pdf | 2023-11-13 15:48 | 36K | |
![[ ]](/icons/layout.gif) | Speaking's Results.pdf | 2023-11-29 14:09 | 87K | |
![[ ]](/icons/layout.gif) | Speak_English_Like_An_American_Idioms.pdf | 2023-11-30 15:46 | 1.5M | |
![[ ]](/icons/layout.gif) | Spaced_out_A_comprehensive_guide_to_award_winning_spaces_in_the.pdf | 2023-11-01 15:47 | 5.0M | |
![[ ]](/icons/layout.gif) | Sozlashuv.pdf | 2023-11-07 10:51 | 1.7M | |
![[ ]](/icons/layout.gif) | Soyasini yo'qotgan odam. A.A'zam.pdf | 2023-10-31 12:53 | 4.7M | |
![[ ]](/icons/layout.gif) | Some_curiosities_of_rings_of_analytic_functions_C_U_Jensen.pdf | 2023-11-01 15:44 | 240K | |
![[ ]](/icons/layout.gif) | Solutions_2nd_-_Pre-Intermediate_-_Student_39_s_Book.pdf | 2023-03-31 12:32 | 77M | |
![[ ]](/icons/layout.gif) | Solutions Pre-Intermediate Student's Book.pdf | 2023-10-27 09:22 | 77M | |
![[ ]](/icons/layout.gif) | Solutions Intermediate Workbook. Jane Hudson.pdf | 2023-11-01 14:32 | 47M | |
![[ ]](/icons/layout.gif) | Solutions Intermediate Student's Book. Tim Falla.pdf | 2023-11-01 14:32 | 41M | |
![[ ]](/icons/layout.gif) | Solutions Elementary. Student's Book_2018.pdf | 2023-10-26 16:16 | 76M | |
![[ ]](/icons/layout.gif) | Solutions Elementary. Student's Book_2018, 3rd -143p.pdf | 2023-11-22 11:33 | 76M | |
![[ ]](/icons/layout.gif) | Solutions Elementary. 2018, 3rd -143p.pdf | 2023-10-27 09:22 | 76M | |
![[ ]](/icons/layout.gif) | Solutions 2nd - Pre-Intermediate - Student 39 s_Book.pdf | 2023-11-22 11:34 | 77M | |
![[ ]](/icons/layout.gif) | Solutions 2nd - Pre-Intermediate - Student 39.pdf | 2023-10-26 16:16 | 77M | |
![[ ]](/icons/layout.gif) | Soddalashtirilgan arab tili grammatikasi.pdf | 2023-11-24 10:51 | 2.3M | |
![[ ]](/icons/layout.gif) | Sociolinguistics.pdf | 2023-10-26 16:16 | 2.9M | |
![[ ]](/icons/layout.gif) | So'zlar_funksional_semantik_sinonimlarning_shakliy_va_manoviy_tabiati.pdf | 2023-10-31 11:42 | 26M | |
![[ ]](/icons/layout.gif) | Smart_Thinking_Skills_for_Critical_Understanding_and_Writing_by.pdf | 2023-10-30 10:12 | 3.6M | |
![[ ]](/icons/layout.gif) | Skills for Effective writing.pdf | 2023-10-27 09:22 | 6.6M | |
![[ ]](/icons/layout.gif) | Skills for Effective Writing Level 4 SB.pdf | 2023-11-22 11:34 | 6.6M | |
![[ ]](/icons/layout.gif) | Skills_for_Effective_Writing_Level_4_SB_.pdf | 2023-11-13 09:52 | 6.6M | |
![[ ]](/icons/layout.gif) | Situational Dialogues_Michael Ockenden_(with Audio).pdf | 2023-11-29 16:00 | 19M | |
![[ ]](/icons/layout.gif) | Sistem tilshunoslik asoslari Sh.Rahmatullayev.pdf | 2023-11-01 14:31 | 6.7M | |
![[ ]](/icons/layout.gif) | Sistem tilshunoslik asoslari. J. Abdullayev.pdf | 2023-11-01 15:45 | 1.5M | |
![[ ]](/icons/layout.gif) | Sistem_tilshunoslik_asoslari_I_kurs_magistirlar_uchun_ma'ruzalar.pdf | 2023-11-01 15:45 | 1.1M | |
![[ ]](/icons/layout.gif) | Sinonimy_i_sinonimichnye_slovosochetania_v_sovremennom_kitayskom.pdf | 2023-11-09 15:34 | 14M | |
![[ ]](/icons/layout.gif) | Simon Task2 writing.pdf | 2023-11-29 15:54 | 1.1M | |
![[ ]](/icons/layout.gif) | Simon Task 2 Model Answers compiled by Diyorbek.pdf | 2023-11-15 10:12 | 449K | |
![[ ]](/icons/layout.gif) | Simon Task 1 Model Answers compiled by Diyorbek.pdf | 2023-11-15 10:12 | 5.2M | |
![[ ]](/icons/layout.gif) | Simon IELTS Writing task 1 Workbook.pdf | 2023-11-13 15:20 | 53M | |
![[ ]](/icons/layout.gif) | Simon IELTS Advice and Tips.pdf | 2023-11-28 17:23 | 1.4M | |
![[ ]](/icons/layout.gif) | Simon's advice for Speaking Part 1.pdf | 2023-11-15 10:14 | 792K | |
![[ ]](/icons/layout.gif) | Shortcut To English Collocations.pdf | 2023-11-29 15:54 | 1.0M | |
![[ ]](/icons/layout.gif) | Sharq tillari-Arab tili-S.Abdunabiyev I.Abdullayeva.pdf | 2023-10-31 11:15 | 9.8M | |
![[ ]](/icons/layout.gif) | Sharq mumtoz poetikasi.H.Boltaboev 2008.pdf | 2023-10-31 12:54 | 6.0M | |
![[ ]](/icons/layout.gif) | Seven ages of you.pdf | 2023-11-15 10:17 | 1.3M | |
![[ ]](/icons/layout.gif) | Seminars in modern english lexicology. Z. T. Tukhtakhodjaeva.pdf | 2023-11-01 14:26 | 453K | |
![[ ]](/icons/layout.gif) | Select Readings 2nd-Elementary.pdf | 2023-11-21 11:04 | 24M | |
![[DIR]](/icons/folder.gif) | Section 4 (audios) and Book/ | 2024-01-03 13:39 | - | |
![[DIR]](/icons/folder.gif) | Section 3 (audios) and Book/ | 2024-01-03 13:39 | - | |
![[DIR]](/icons/folder.gif) | Section 2 (audios) and Book/ | 2024-01-03 13:39 | - | |
![[DIR]](/icons/folder.gif) | Section 1 (audios) and Book/ | 2024-01-03 13:38 | - | |
![[ ]](/icons/layout.gif) | Second Language Writing.pdf | 2023-11-06 09:54 | 2.9M | |
![[ ]](/icons/layout.gif) | Schaum_Outlines_Chinese_Vocabulary.pdf | 2023-11-07 10:55 | 21M | |
![[ ]](/icons/layout.gif) | Say This to the IELTS Examiner.pdf | 2023-11-15 10:13 | 517K | |
![[ ]](/icons/layout.gif) | Saudiya adabiyotida roman.S.S.Qahtoniy..pdf | 2023-10-30 15:12 | 8.4M | |
![[ ]](/icons/layout.gif) | Sardor Hafizov Ingliz tili grammatikasi.pdf | 2023-11-21 11:03 | 7.2M | |
![[ ]](/icons/layout.gif) | Sample letters.pdf | 2023-11-30 15:47 | 856K | |
![[ ]](/icons/layout.gif) | Sample band 9 Essays from IELTS.pdf | 2023-11-15 10:15 | 451K | |
![[ ]](/icons/layout.gif) | Sample Answers in Part 1.pdf | 2023-11-29 14:09 | 82K | |
![[ ]](/icons/layout.gif) | Sample 7️. 5️Answers Accomadation.pdf | 2023-11-29 14:09 | 78K | |
![[ ]](/icons/layout.gif) | Sample 7️⃣.5️⃣ Answers. Studies.pdf | 2023-11-29 15:51 | 64K | |
![[ ]](/icons/layout.gif) | SNUWB1A.pdf | 2023-11-02 11:18 | 82M | |
![[ ]](/icons/layout.gif) | Rus tilining amaliy grammatikasi.pdf | 2023-11-17 10:13 | 3.8M | |
![[ ]](/icons/layout.gif) | Rus tilini mustaqil o'rganish.pdf | 2023-11-21 11:03 | 3.8M | |
![[ ]](/icons/layout.gif) | Russian-Studies-In-Islamic-Civilization-Complete.pdf | 2023-10-26 16:53 | 9.7M | |
![[ ]](/icons/layout.gif) | Ruscha-uzbekcha_lugat_2.pdf | 2023-11-17 10:39 | 80M | |
![[ ]](/icons/layout.gif) | Ruscha-uzbekcha_lugat_1.pdf | 2023-11-17 10:39 | 80M | |
![[ ]](/icons/layout.gif) | Rus_tili_4_uzb.pdf | 2023-11-15 10:21 | 5.2M | |
![[ ]](/icons/layout.gif) | Rus_tili_3_uzb.pdf | 2023-11-15 10:20 | 5.4M | |
![[ ]](/icons/layout.gif) | Rule_#6_Be_clear_about_how_the_examiner_will_assess_your_level.pdf | 2023-11-29 14:09 | 70K | |
![[ ]](/icons/layout.gif) | Rule -#5 Know what to expect from the test.pdf | 2023-11-29 14:09 | 55K | |
![[ ]](/icons/layout.gif) | Rule #10 Avoid some common mistakes.pdf | 2023-11-29 14:09 | 83K | |
![[ ]](/icons/layout.gif) | Rule #9 Master the most useful Words for the test.pdf | 2023-11-29 14:09 | 63K | |
![[ ]](/icons/layout.gif) | Rule #8 Three language tips.pdf | 2023-11-29 14:09 | 76K | |
![[ ]](/icons/layout.gif) | Rule #7 How to plan for Part 2.pdf | 2023-11-29 14:09 | 75K | |
![[ ]](/icons/layout.gif) | Rule #4 How to prepare.pdf | 2023-11-29 14:09 | 73K | |
![[ ]](/icons/layout.gif) | Rozental_Ditmar_Sovremennyi_russ.pdf | 2023-11-02 11:21 | 21M | |
![[ ]](/icons/layout.gif) | Round-up_starter_-_student_39_s_book-1.pdf | 2023-11-13 09:52 | 19M | |
![[ ]](/icons/layout.gif) | Round-Up 6_new and update.pdf | 2023-11-15 10:19 | 20M | |
![[ ]](/icons/layout.gif) | Round-Up 5_new and update.pdf | 2023-11-15 10:18 | 44M | |
![[ ]](/icons/layout.gif) | Round-Up 4_new and update.pdf | 2023-11-15 10:18 | 36M | |
![[ ]](/icons/layout.gif) | Round-Up 3_new and update.pdf | 2023-11-15 10:18 | 27M | |
![[ ]](/icons/layout.gif) | Round-Up 2_new and update.pdf | 2023-11-15 09:55 | 23M | |
![[ ]](/icons/layout.gif) | Round-Up 1_new and update.pdf | 2023-11-15 09:55 | 16M | |
![[ ]](/icons/layout.gif) | Roman_german_filologiyasiga_kirish..pdf | 2023-11-06 16:05 | 951K | |
![[ ]](/icons/layout.gif) | Roma_dr_success_to_ieltstips_and_techniques.pdf | 2023-11-06 10:09 | 2.9M | |
![[ ]](/icons/layout.gif) | Roche_marc_ielts_vocabulary_masterclass_85_book_2_master_iel.pdf | 2023-11-29 15:56 | 1.3M | |
![[ ]](/icons/layout.gif) | Reading task(partial).pdf | 2023-11-30 15:46 | 485K | |
![[ ]](/icons/layout.gif) | Reading for Mock test6.pdf | 2023-11-29 15:52 | 2.6M | |
![[ ]](/icons/layout.gif) | Reading for Mock test5.pdf | 2023-11-29 15:52 | 2.4M | |
![[ ]](/icons/layout.gif) | Reading for Mock test2.pdf | 2023-11-29 15:52 | 2.6M | |
![[ ]](/icons/layout.gif) | Reading for Mock test.pdf | 2023-11-29 14:09 | 2.2M | |
![[ ]](/icons/layout.gif) | Reading for Mock test .pdf | 2023-11-29 15:51 | 2.2M | |
![[ ]](/icons/layout.gif) | Reading for Mock test (16).pdf | 2023-11-29 15:58 | 3.1M | |
![[ ]](/icons/layout.gif) | Reading for Mock test (13).pdf | 2023-11-29 15:54 | 1.7M | |
![[ ]](/icons/layout.gif) | Reading for Mock test (11).pdf | 2023-11-29 15:54 | 2.3M | |
![[ ]](/icons/layout.gif) | Reading for Mock test (10).pdf | 2023-11-29 15:53 | 1.7M | |
![[ ]](/icons/layout.gif) | Reading for Mock test (9).pdf | 2023-11-29 15:53 | 3.1M | |
![[ ]](/icons/layout.gif) | Reading for Mock test (7).pdf | 2023-11-29 15:53 | 2.9M | |
![[ ]](/icons/layout.gif) | Reading for Mock Test4.pdf | 2023-11-29 15:52 | 2.7M | |
![[ ]](/icons/layout.gif) | Reading for Mock Test3.pdf | 2023-11-29 15:52 | 2.7M | |
![[ ]](/icons/layout.gif) | Reading for Mock.pdf | 2023-11-29 15:54 | 1.5M | |
![[ ]](/icons/layout.gif) | Reading for Mock (2).pdf | 2023-11-29 15:56 | 1.6M | |
![[ ]](/icons/layout.gif) | Reading answers with explanations for Mock test .pdf | 2023-11-29 15:52 | 696K | |
![[ ]](/icons/layout.gif) | Reading answers with explanations for Mock test (2).pdf | 2023-11-29 15:52 | 1.0M | |
![[ ]](/icons/layout.gif) | Reading answers with explanations .pdf | 2023-11-29 15:52 | 863K | |
![[ ]](/icons/layout.gif) | Reading answers with explanations (2).pdf | 2023-11-29 15:55 | 863K | |
![[ ]](/icons/layout.gif) | Reading answers of Mock test .pdf | 2023-11-29 15:52 | 802K | |
![[ ]](/icons/layout.gif) | Reading answers for Mock test1.pdf | 2023-11-29 15:52 | 800K | |
![[ ]](/icons/layout.gif) | Reading answers for Mock test .pdf | 2023-11-29 15:51 | 933K | |
![[ ]](/icons/layout.gif) | Reading answers .pdf | 2023-11-29 15:52 | 807K | |
![[ ]](/icons/layout.gif) | Reading_answers_with_explanations_for_Mock_test_to_understand_all.pdf | 2023-11-29 15:52 | 704K | |
![[ ]](/icons/layout.gif) | Reading_Test IELTS.pdf | 2023-11-29 14:09 | 4.1M | |
![[ ]](/icons/layout.gif) | Reading_Test.pdf | 2023-11-29 15:51 | 4.1M | |
![[ ]](/icons/layout.gif) | Reading_Task_Fascinating_Materials_for_IELTS_students_with_Shaxzod.pdf | 2023-11-29 15:51 | 2.8M | |
![[ ]](/icons/layout.gif) | Reading Test for Mock test .pdf | 2023-11-29 15:52 | 2.4M | |
![[ ]](/icons/layout.gif) | Reading Test 4.pdf | 2023-11-29 15:54 | 2.3M | |
![[ ]](/icons/layout.gif) | Reading Test 4 (2).pdf | 2023-11-29 16:00 | 9.3M | |
![[ ]](/icons/layout.gif) | Reading Test 4 (1).pdf | 2023-11-29 15:55 | 2.1M | |
![[ ]](/icons/layout.gif) | Reading Test 3.pdf | 2023-11-29 15:54 | 2.2M | |
![[ ]](/icons/layout.gif) | Reading Test 3 (4).pdf | 2023-11-29 16:00 | 9.1M | |
![[ ]](/icons/layout.gif) | Reading Test 3 (3).pdf | 2023-11-29 15:59 | 6.2M | |
![[ ]](/icons/layout.gif) | Reading Test 3 (2).pdf | 2023-11-29 15:55 | 2.7M | |
![[ ]](/icons/layout.gif) | Reading Test 2.pdf | 2023-11-29 16:00 | 9.9M | |
![[ ]](/icons/layout.gif) | Reading Test 2 (4).pdf | 2023-11-29 16:00 | 6.1M | |
![[ ]](/icons/layout.gif) | Reading Test 2 (3).pdf | 2023-11-29 15:59 | 6.1M | |
![[ ]](/icons/layout.gif) | Reading Test 1.pdf | 2023-11-29 15:54 | 2.4M | |
![[ ]](/icons/layout.gif) | Reading Test 1 (6).pdf | 2023-11-29 16:00 | 7.8M | |
![[ ]](/icons/layout.gif) | Reading Test 1 (5).pdf | 2023-11-29 16:00 | 6.5M | |
![[ ]](/icons/layout.gif) | Reading Test 1 (4).pdf | 2023-11-29 16:00 | 6.5M | |
![[ ]](/icons/layout.gif) | Reading Test 1 (2).pdf | 2023-11-29 15:56 | 2.6M | |
![[ ]](/icons/layout.gif) | Reading Test 1 (1).pdf | 2023-11-29 15:55 | 2.6M | |
![[ ]](/icons/layout.gif) | Reading Task.pdf | 2023-11-29 15:51 | 2.5M | |
![[ ]](/icons/layout.gif) | Reading Multiple Choice.pdf | 2023-11-30 15:47 | 2.3M | |
![[ ]](/icons/layout.gif) | Reading Mock Test.pdf | 2023-11-29 15:54 | 1.6M | |
![[ ]](/icons/layout.gif) | Reading Answers.pdf | 2023-11-30 15:46 | 236K | |
![[ ]](/icons/layout.gif) | Reading Answers -pagenumbered-watermarked.pdf | 2023-11-29 15:51 | 498K | |
![[ ]](/icons/layout.gif) | Reading Actual Volume test 2.pdf | 2023-11-29 16:03 | 108M | |
![[ ]](/icons/layout.gif) | Reading Actual Volume test 2(1).pdf | 2023-11-29 16:03 | 108M | |
![[ ]](/icons/layout.gif) | Reading Academic May-August 2021.pdf | 2023-11-29 16:00 | 6.9M | |
![[ ]](/icons/layout.gif) | Reading A2+ Level.pdf | 2023-11-30 15:47 | 545K | |
![[ ]](/icons/layout.gif) | Reading 7+.pdf | 2023-11-30 15:46 | 821K | |
![[ ]](/icons/layout.gif) | Reading 1.pdf | 2023-11-29 15:53 | 167K | |
![[ ]](/icons/layout.gif) | Reading-part-5.pdf | 2023-11-30 15:46 | 301K | |
![[ ]](/icons/layout.gif) | Read and Understand 2.pdf | 2023-11-29 14:08 | 8.2M | |
![[ ]](/icons/layout.gif) | Read and Understand 1.pdf | 2023-11-29 14:08 | 9.0M | |
![[ ]](/icons/layout.gif) | Read_and_Understand_3_Betty_Kirkpatrick_&_Rebecca_Mok_2005_with.pdf | 2023-11-29 16:00 | 7.7M | |
![[ ]](/icons/layout.gif) | Raymond Murphy red.pdf | 2023-11-13 15:50 | 15M | |
![[ ]](/icons/layout.gif) | Rakh_imov_g_kh_tarzhima_nazariyasi_va_amaliyoti.pdf | 2023-11-22 11:27 | 2.4M | |
![[ ]](/icons/layout.gif) | Radicals.pdf | 2023-11-07 10:51 | 495K | |
![[ ]](/icons/layout.gif) | Question types. How often.pdf | 2023-11-29 15:51 | 74K | |
![[ ]](/icons/layout.gif) | Questions types. Do you like .pdf | 2023-11-29 15:51 | 62K | |
![[ ]](/icons/layout.gif) | Qualitative research in applied linguistics.pdf | 2023-10-26 16:16 | 2.2M | |
![[ ]](/icons/layout.gif) | Qdoc.tips_ielts-advantage-writing-skills.pdf | 2023-11-30 15:48 | 8.8M | |
![[ ]](/icons/layout.gif) | Qadimgi dunyo tarixi 6-sinf.pdf | 2023-11-21 11:45 | 7.9M | |
![[ ]](/icons/layout.gif) | QUTADG'U BILIG.pdf | 2023-11-13 15:18 | 229K | |
![[ ]](/icons/layout.gif) | Q&A Keith Speaking Academy.pdf | 2023-11-15 10:12 | 942K | |
![[DIR]](/icons/folder.gif) | Pronounciation/ | 2024-01-03 13:37 | - | |
![[ ]](/icons/layout.gif) | Professional-english-use-computer-internet.pdf | 2023-11-20 11:49 | 20M | |
![[ ]](/icons/layout.gif) | Problem and solution.pdf | 2023-11-29 14:09 | 640K | |
![[ ]](/icons/layout.gif) | Preliminary english test 8.pdf | 2023-11-30 15:49 | 21M | |
![[ ]](/icons/layout.gif) | Preliminary english test 1.pdf | 2023-11-30 15:49 | 19M | |
![[ ]](/icons/layout.gif) | Preliminary English Test 7.pdf | 2023-11-30 15:51 | 61M | |
![[ ]](/icons/layout.gif) | Preliminary English Test 6.pdf | 2023-11-30 15:50 | 47M | |
![[ ]](/icons/layout.gif) | Preliminary English Test 5.pdf | 2023-11-30 15:48 | 9.1M | |
![[ ]](/icons/layout.gif) | Preliminary English Test 4.pdf | 2023-11-30 15:48 | 8.3M | |
![[ ]](/icons/layout.gif) | Preliminary English Test 3.pdf | 2023-11-30 15:48 | 8.0M | |
![[ ]](/icons/layout.gif) | Preliminary English Test.pdf | 2023-11-30 15:50 | 42M | |
![[DIR]](/icons/folder.gif) | Pre intermediate book/ | 2024-01-03 13:35 | - | |
![[ ]](/icons/layout.gif) | Pre-int_int_placement_test.pdf | 2023-11-13 14:34 | 189K | |
![[ ]](/icons/layout.gif) | Practice-Makes-Perfect-English-Conversation-PDF.pdf | 2023-11-29 15:58 | 3.5M | |
![[ ]](/icons/layout.gif) | Practical ling.pdf | 2023-10-26 16:16 | 1.2M | |
![[ ]](/icons/layout.gif) | PracticalchineseT1.pdf | 2023-11-07 10:51 | 13M | |
![[ ]](/icons/layout.gif) | Practical IELTS Strategies 2.pdf | 2023-11-29 16:02 | 50M | |
![[ ]](/icons/layout.gif) | Powerful_Vocabulary_for_Reading_Success_Student's.pdf | 2023-11-15 09:56 | 2.2M | |
![[ ]](/icons/layout.gif) | Powerful_Vocabulary_for_Reading_Success_Student's (3).pdf | 2023-11-15 10:12 | 2.2M | |
![[ ]](/icons/layout.gif) | Powerful_Vocabulary_for_Reading_Success_Student's (2).pdf | 2023-11-15 10:18 | 2.5M | |
![[ ]](/icons/layout.gif) | Positives and Negatives of Public Transport .pdf | 2023-11-29 14:09 | 59K | |
![[DIR]](/icons/folder.gif) | Plus 3 audios and book/ | 2024-01-03 13:35 | - | |
![[DIR]](/icons/folder.gif) | Plus 2 audios and Book/ | 2024-01-03 13:35 | - | |
![[ ]](/icons/layout.gif) | Plain English for Lawyers (Richard C. Wydick).pdf | 2023-11-17 10:38 | 5.4M | |
![[ ]](/icons/layout.gif) | Pielts-Simon-Reading-arargraph-headings-worksheet-4.pdf | 2023-11-29 14:09 | 70K | |
![[ ]](/icons/layout.gif) | Phrases Expressing like and dislike.pdf | 2023-11-29 15:51 | 65K | |
![[ ]](/icons/layout.gif) | Phrasal Verbs in Context.pdf | 2023-11-15 10:15 | 61M | |
![[ ]](/icons/layout.gif) | Phrasal Verbs In Use - Multi.pdf | 2023-11-30 15:51 | 77M | |
![[ ]](/icons/layout.gif) | Phrasal Verbs In Use - Advanced.pdf | 2023-11-30 15:48 | 5.4M | |
![[ ]](/icons/layout.gif) | Paronimlar_lugati.pdf | 2023-11-21 12:40 | 479K | |
![[ ]](/icons/layout.gif) | Paraphrasing_Strategies_10_Simple_Techniques_For_Effective_Paraphrasing.pdf | 2023-11-15 10:19 | 259K | |
![[ ]](/icons/layout.gif) | Oxford word skills for students .pdf | 2023-11-28 17:31 | 107M | |
![[ ]](/icons/layout.gif) | Oxford_primary_skills_4_SB.pdf | 2023-11-29 10:47 | 16M | |
![[ ]](/icons/layout.gif) | Oxford_Primary_Skills_3_-_Book (4).pdf | 2023-11-29 10:47 | 15M | |
![[ ]](/icons/layout.gif) | Oxford_Primary_Skills_2_-_Book (7).pdf | 2023-11-29 10:47 | 13M | |
![[ ]](/icons/layout.gif) | Oxford_Picture_Dictionary_Monolingual_English_by_Jayme_Adelson_Goldstein.pdf | 2023-11-29 10:51 | 49M | |
![[ ]](/icons/layout.gif) | Oxford Writing Tutor.pdf | 2023-11-29 16:01 | 23M | |
![[ ]](/icons/layout.gif) | Oxford Word Skills basic.pdf | 2023-11-29 12:33 | 78M | |
![[ ]](/icons/layout.gif) | Oxford Word Skills Intermediate.pdf | 2023-11-29 12:32 | 51M | |
![[DIR]](/icons/folder.gif) | Oxford Word Skills Intermediate - CD-ROM/ | 2024-01-03 13:34 | - | |
![[ ]](/icons/layout.gif) | Oxford Word Skills Intermediate - Book.pdf | 2023-11-29 16:04 | 51M | |
![[ ]](/icons/layout.gif) | Oxford Word Skills Basic - Book.pdf | 2023-11-29 16:06 | 78M | |
![[ ]](/icons/layout.gif) | Oxford Word Skills Advanced.pdf | 2023-11-29 12:32 | 52M | |
![[ ]](/icons/layout.gif) | Oxford Primary Skills 2.pdf | 2023-11-28 17:25 | 14M | |
![[ ]](/icons/layout.gif) | Oxford Primary Skills 1. Reading and Writing.pdf | 2023-11-29 10:46 | 12M | |
![[DIR]](/icons/folder.gif) | Oxford KET Practice Test CD/ | 2024-01-03 13:32 | - | |
![[ ]](/icons/layout.gif) | Oxford KET Practice Test.pdf | 2023-11-29 10:49 | 34M | |
![[ ]](/icons/layout.gif) | Oxford Collocations.pdf | 2023-11-29 14:13 | 29M | |
![[ ]](/icons/layout.gif) | Oson_한국어_초급_2_watermark_compressed (1).pdf | 2023-11-02 11:20 | 6.3M | |
![[ ]](/icons/layout.gif) | Oson_한국어_초급_1.pdf | 2023-11-02 11:20 | 19M | |
![[ ]](/icons/layout.gif) | Official guide book.pdf | 2023-11-06 09:40 | 63M | |
![[ ]](/icons/unknown.gif) | Official IELTS Practice Materials.PDF | 2023-11-29 15:55 | 18M | |
![[ ]](/icons/unknown.gif) | Official IELTS Practice Materials-2.PDF | 2023-11-29 16:03 | 59M | |
![[ ]](/icons/layout.gif) | Official.IELTS.Practice.Material.pdf | 2023-11-21 11:04 | 19M | |
![[ ]](/icons/layout.gif) | O'zbek tilshunosligi muammolari.R.Rasulov.pdf | 2023-10-31 11:56 | 38M | |
![[ ]](/icons/layout.gif) | O'zbek tili me'yorlari punktuatsiya.pdf | 2023-10-30 15:11 | 7.7M | |
![[ ]](/icons/layout.gif) | O'zbekiston tarixi.Q.Usmonov va boshqalar.pdf | 2023-10-31 15:57 | 40M | |
![[ ]](/icons/layout.gif) | O'zbekistondagi_bazi_toponimlarning_etimologik_talqini_T_Enazarov.pdf | 2023-10-30 15:10 | 4.3M | |
![[ ]](/icons/layout.gif) | O'zbekcha-inglizcha lug'at (William Dirks).pdf | 2023-11-13 15:19 | 3.2M | |
![[ ]](/icons/layout.gif) | O'zbek adabiyoti namunalari arab tilida.pdf | 2023-10-31 11:50 | 2.7M | |
![[ ]](/icons/layout.gif) | O'zbek_tilidagi_arabiy_so'zlar_imlosi_Nigora_Sulaymonova.pdf | 2023-10-30 15:11 | 6.0M | |
![[ ]](/icons/layout.gif) | O'zbek_terminologiyasi_bugungi_holati_va_istiqboli_Sh_Sirojiddinov.pdf | 2023-10-31 11:20 | 65M | |
![[ ]](/icons/layout.gif) | O'zbek_adabiyoti_va_adabiy_aloqalari_tarixi_B_Qosimov2008_yil.pdf | 2023-10-30 15:11 | 17M | |
![[ ]](/icons/layout.gif) | Oʻzbekiston tarix 11-sinf.pdf | 2023-11-21 11:45 | 2.4M | |
![[ ]](/icons/layout.gif) | Oʻzbekiston tarix 10-sinf.pdf | 2023-11-21 11:45 | 1.8M | |
![[ ]](/icons/layout.gif) | Oʻzbekiston tarix 9-sinf.pdf | 2023-11-21 11:45 | 6.9M | |
![[ ]](/icons/layout.gif) | Oʻzbekiston tarix 8-sinf.pdf | 2023-11-21 11:45 | 2.4M | |
![[ ]](/icons/layout.gif) | New Round up 4 V irginia Evans - Jenny Dooley Marina Osipova.pdf | 2023-11-13 09:51 | 11M | |
![[ ]](/icons/layout.gif) | New Round up 3 Virginia Evans - Jenny Dooley.pdf | 2023-11-13 09:51 | 9.3M | |
![[ ]](/icons/layout.gif) | New Round up 3.pdf | 2023-11-29 14:08 | 9.3M | |
![[ ]](/icons/layout.gif) | New Round up 2 V irginia Evans - Jenny Dooley.pdf | 2023-11-13 09:51 | 9.5M | |
![[ ]](/icons/layout.gif) | New Round up 1.pdf | 2023-11-29 14:08 | 6.2M | |
![[ ]](/icons/layout.gif) | New Round Up 6 V irginia Evans - Jenny Dooley.pdf | 2023-11-13 09:51 | 13M | |
![[ ]](/icons/layout.gif) | New Round Up 5 TB V irginia Evans - Jenny Dooley.pdf | 2023-11-13 09:51 | 1.9M | |
![[ ]](/icons/layout.gif) | New Round Up 1 TB V irginia Evans - Jenny Dooley.pdf | 2023-11-13 09:51 | 2.0M | |
![[DIR]](/icons/folder.gif) | New Round-Up 6(audio) and Book/ | 2024-01-03 13:30 | - | |
![[DIR]](/icons/folder.gif) | New Round-Up 5(audio) and Book/ | 2024-01-03 13:30 | - | |
![[DIR]](/icons/folder.gif) | New Round-Up 4(audio) and Book/ | 2024-01-03 13:30 | - | |
![[DIR]](/icons/folder.gif) | New Round-Up 3(audio) and Book/ | 2024-01-03 13:30 | - | |
![[DIR]](/icons/folder.gif) | New Round-Up 2(audio) and Book/ | 2024-01-03 13:30 | - | |
![[ ]](/icons/layout.gif) | New Round-Up 1.pdf | 2023-11-13 09:52 | 6.2M | |
![[DIR]](/icons/folder.gif) | New Round-Up 1(audio) and book/ | 2024-01-03 13:30 | - | |
![[DIR]](/icons/folder.gif) | New Round-Up 0 starter(audio) and book/ | 2024-01-03 13:30 | - | |
![[VID]](/icons/movie.gif) | New Practical Chinese Reader(10).wmv | 2023-11-07 10:51 | 6.7M | |
![[ ]](/icons/layout.gif) | New English File.pdf | 2023-11-29 12:30 | 22M | |
![[ ]](/icons/layout.gif) | Nemis tili 6.pdf | 2023-11-21 11:47 | 13M | |
![[ ]](/icons/layout.gif) | Nemis_tili_daftar_4_uzb.pdf | 2023-11-15 10:21 | 6.0M | |
![[ ]](/icons/layout.gif) | Nemis_tili_daftar_3_uzb.pdf | 2023-11-15 10:20 | 5.4M | |
![[ ]](/icons/layout.gif) | Nemis_tili_3_uzb.pdf | 2023-11-15 10:20 | 4.7M | |
![[ ]](/icons/layout.gif) | Nemis-tili.pdf | 2023-11-21 12:40 | 158K | |
![[ ]](/icons/layout.gif) | Nematullo_Ibrohimov,_Muhammad_Yusupov_Arab_tili_grammatikasi_2_jild.pdf | 2023-11-22 11:27 | 13M | |
![[ ]](/icons/layout.gif) | Ne'matullo_Ibrohimov,_Muhammad_Yusupov_Arab_tili_grammatikasi_2.pdf | 2023-10-26 16:53 | 13M | |
![[ ]](/icons/layout.gif) | Navigate_ targeted language based activities.pdf | 2023-11-28 17:23 | 2.5M | |
![[ ]](/icons/layout.gif) | Navigate Beginner A1 Workbook_2016 -103p.pdf | 2023-11-13 15:19 | 28M | |
![[ ]](/icons/layout.gif) | N. A. Bonk Учебник анлийского языка 1 часть.pdf | 2023-11-24 10:57 | 19M | |
![[ ]](/icons/layout.gif) | Myth or reality “introducyion to critical reading”.pdf | 2023-10-26 16:16 | 3.4M | |
![[ ]](/icons/layout.gif) | Murphy_raymond_english_grammar_in_use 2.pdf | 2023-11-20 12:05 | 28M | |
![[ ]](/icons/layout.gif) | Murphy_raymond_english_grammar_in_use.pdf | 2023-11-20 12:05 | 34M | |
![[ ]](/icons/layout.gif) | Multilevel Master Listening.pdf | 2023-11-28 17:29 | 44M | |
![[ ]](/icons/layout.gif) | Multi_level_reading_test.pdf | 2023-11-30 15:47 | 2.9M | |
![[ ]](/icons/layout.gif) | Multi-level speaking.pdf | 2023-11-30 15:46 | 662K | |
![[ ]](/icons/layout.gif) | Muhammad Yusuf. Qora quyosh, osmonning oxiri dostoni.pdf | 2023-11-22 11:08 | 608K | |
![[ ]](/icons/layout.gif) | Muallimi_soniy.pdf | 2023-11-20 17:52 | 7.4M | |
![[ ]](/icons/layout.gif) | Most Commonly Used 800 Idioms.pdf | 2023-11-30 15:46 | 1.0M | |
![[ ]](/icons/layout.gif) | Most Common Idioms.pdf | 2023-11-29 15:54 | 125K | |
![[DIR]](/icons/folder.gif) | Mock Test 6/ | 2024-01-03 13:24 | - | |
![[DIR]](/icons/folder.gif) | Mock Test 4/ | 2024-01-03 13:24 | - | |
![[DIR]](/icons/folder.gif) | Mock Test 1/ | 2024-01-03 13:24 | - | |
![[ ]](/icons/layout.gif) | Mock Results-converted.pdf | 2023-11-29 14:09 | 95K | |
![[DIR]](/icons/folder.gif) | MindSet for IELTS Foundation SB (audios&boook)/ | 2024-01-03 13:24 | - | |
![[DIR]](/icons/folder.gif) | MindSet for IELTS 3 SB (audios)/ | 2024-01-03 13:24 | - | |
![[DIR]](/icons/folder.gif) | MindSet for IELTS 1 SB (audios&book)/ | 2024-01-03 13:24 | - | |
![[DIR]](/icons/folder.gif) | MindSet-for-IELTS-2-SB-_audios_/ | 2024-01-03 13:24 | - | |
![[ ]](/icons/layout.gif) | Mein Kampf - English - Adolf Hitler - PDF.pdf | 2023-11-29 12:27 | 3.2M | |
![[ ]](/icons/layout.gif) | Maximizer speaking.pdf | 2023-11-30 15:50 | 41M | |
![[ ]](/icons/layout.gif) | Maximizer speaking .pdf | 2023-11-30 15:49 | 41M | |
![[ ]](/icons/layout.gif) | Maximiser_Reading.pdf | 2023-11-30 15:50 | 46M | |
![[ ]](/icons/layout.gif) | Maximiser Speaking.pdf | 2023-11-14 11:32 | 9.2M | |
![[ ]](/icons/layout.gif) | Mat.Clark.Speaking.2007.pdf | 2023-11-15 09:55 | 10M | |
![[ ]](/icons/layout.gif) | Master the Most-WPS Office.pdf | 2023-11-16 17:01 | 186K | |
![[ ]](/icons/layout.gif) | Mastering+IELTS+Writing+Task+1+(PDF_eBook).pdf | 2023-11-29 15:59 | 11M | |
![[ ]](/icons/layout.gif) | Master_ielts_essays.pdf | 2023-11-30 15:46 | 1.2M | |
![[ ]](/icons/layout.gif) | Master IELTS Visuals.pdf | 2023-11-22 11:34 | 3.8M | |
![[ ]](/icons/layout.gif) | Master IELTS Visuals, writing task.pdf | 2023-10-27 09:22 | 3.8M | |
![[ ]](/icons/layout.gif) | Master IELTS Speaking.pdf | 2023-11-29 15:56 | 1.5M | |
![[ ]](/icons/layout.gif) | Master IELTS Speaking (1).pdf | 2023-11-29 15:56 | 1.5M | |
![[ ]](/icons/layout.gif) | Makkar Pdf Jan to April 2023.pdf | 2023-11-29 16:00 | 7.2M | |
![[ ]](/icons/layout.gif) | MakkarIELTS_Speaking_Jan_Apr_2022_First_Version_9_Jan_22_3.pdf | 2023-11-29 16:00 | 6.1M | |
![[ ]](/icons/layout.gif) | MakkarIELTS Speaking Sep Dec 2021.pdf | 2023-11-29 14:08 | 8.7M | |
![[ ]](/icons/layout.gif) | Makkar IELTS Speaking Guesswork Jan-April 2021.pdf | 2023-11-13 12:06 | 8.0M | |
![[ ]](/icons/layout.gif) | Makkar IELTS Reading Vol 2.pdf | 2023-11-28 17:32 | 67M | |
![[ ]](/icons/layout.gif) | Makkar IELTS Reading Vol 1.pdf | 2023-11-15 10:12 | 11M | |
![[ ]](/icons/layout.gif) | Madinah_arabic_reader_book_1_novoe_izdanie_medinskogo_kursa_5.pdf | 2023-11-22 11:27 | 7.9M | |
![[ ]](/icons/layout.gif) | Madinah_arabic_reader_book_1_novoe_izdanie_medinskogo_kursa_5 (1).pdf | 2023-11-22 11:29 | 7.9M | |
![[DIR]](/icons/folder.gif) | Macmillan_En/ | 2024-01-03 13:22 | - | |
![[ ]](/icons/layout.gif) | Macmillan English Grammar in Context Intermediate.pdf | 2023-11-15 10:17 | 13M | |
![[ ]](/icons/layout.gif) | Macmillan English Grammar in Context Essential.pdf | 2023-11-15 10:17 | 50M | |
![[ ]](/icons/layout.gif) | Macmillan English Grammar in Context Advanced.pdf | 2023-11-15 10:17 | 8.4M | |
![[ ]](/icons/layout.gif) | M_Hoy,J_Llivernois,_C_McKenna,_R_Rees,_T_Stengosl_Mathematics.pdf | 2023-11-29 12:30 | 39M | |
![[ ]](/icons/layout.gif) | MOCK answers(Coach_Ali_Sher).pdf | 2023-11-30 15:47 | 83K | |
![[ ]](/icons/layout.gif) | MOCK.pdf | 2023-11-30 15:46 | 899K | |
![[ ]](/icons/layout.gif) | MOCK (1).pdf | 2023-11-30 15:47 | 899K | |
![[ ]](/icons/layout.gif) | ML reading part 3 & 4 (2).pdf | 2023-11-30 15:47 | 506K | |
![[ ]](/icons/layout.gif) | ML Full Practice test 1.pdf | 2023-11-30 15:46 | 1.3M | |
![[ ]](/icons/layout.gif) | ML Full Practice test 1 (1).pdf | 2023-11-30 15:46 | 1.3M | |
![[ ]](/icons/layout.gif) | M.G apporov, R.Qosimova - Ingliz tili gram.pdf | 2023-11-17 10:37 | 1.5M | |
![[ ]](/icons/layout.gif) | Lug'at va semantika.pdf | 2023-11-22 11:27 | 4.9M | |
![[ ]](/icons/layout.gif) | Love is the drug.pdf | 2023-11-30 15:46 | 109K | |
![[ ]](/icons/layout.gif) | Lizs-ideas-for-essay.pdf | 2023-11-29 14:09 | 6.9M | |
![[ ]](/icons/layout.gif) | Liz's ideas for essay.pdf | 2023-11-29 16:00 | 6.9M | |
![[ ]](/icons/layout.gif) | Literature_as_afactor_for_development_of_morality_and_independent.pdf | 2023-10-30 16:16 | 113M | |
![[ ]](/icons/layout.gif) | Listening task for Mock test .pdf | 2023-11-29 15:52 | 775K | |
![[ ]](/icons/layout.gif) | Listening for Mock test10.pdf | 2023-11-29 15:53 | 477K | |
![[ ]](/icons/layout.gif) | Listening for Mock test5.pdf | 2023-11-29 15:52 | 768K | |
![[ ]](/icons/layout.gif) | Listening for Mock test3.pdf | 2023-11-29 15:52 | 907K | |
![[ ]](/icons/layout.gif) | Listening for Mock test 3.pdf | 2023-11-29 15:52 | 617K | |
![[ ]](/icons/layout.gif) | Listening for Mock test2.pdf | 2023-11-29 15:52 | 907K | |
![[ ]](/icons/layout.gif) | Listening for Mock test 2.pdf | 2023-11-29 15:52 | 613K | |
![[ ]](/icons/layout.gif) | Listening for Mock test.pdf | 2023-11-29 15:53 | 861K | |
![[ ]](/icons/layout.gif) | Listening for Mock test .pdf | 2023-11-29 15:51 | 588K | |
![[ ]](/icons/layout.gif) | Listening for Mock test (8).pdf | 2023-11-29 15:53 | 545K | |
![[ ]](/icons/layout.gif) | Listening for Mock test (7).pdf | 2023-11-29 15:52 | 890K | |
![[ ]](/icons/layout.gif) | Listening for Mock test(3).pdf | 2023-11-29 15:53 | 680K | |
![[ ]](/icons/layout.gif) | Listening for Mock test(2).pdf | 2023-11-29 15:53 | 764K | |
![[ ]](/icons/layout.gif) | Listening for Mock test (1).pdf | 2023-11-29 15:52 | 835K | |
![[ ]](/icons/layout.gif) | Listening for MOCK Test (11).pdf | 2023-11-29 15:53 | 490K | |
![[ ]](/icons/layout.gif) | Listening answers of Mock test.pdf | 2023-11-29 15:53 | 63K | |
![[ ]](/icons/layout.gif) | Listening answers for Mock test4.pdf | 2023-11-29 15:53 | 56K | |
![[ ]](/icons/layout.gif) | Listening answers for Mock test.pdf | 2023-11-29 15:53 | 62K | |
![[ ]](/icons/layout.gif) | Listening answers for Mock test .pdf | 2023-11-29 15:51 | 2.2M | |
![[ ]](/icons/layout.gif) | Listening_answers_with_tapescrips_to_understand_all_mistakes_.pdf | 2023-11-29 15:52 | 2.6M | |
![[ ]](/icons/layout.gif) | Listening_answers_with_tapescrips_to_understand_all_mistakes_ (6).pdf | 2023-11-29 15:53 | 2.5M | |
![[ ]](/icons/layout.gif) | Listening_answers_with_tapescrips_to_understand_all_mistakes_ (5).pdf | 2023-11-29 15:52 | 2.2M | |
![[ ]](/icons/layout.gif) | Listening_answers_with_tapescrips_to_understand_all_mistakes_ (4).pdf | 2023-11-29 15:52 | 2.5M | |
![[ ]](/icons/layout.gif) | Listening_answers_with_tapescrips_to_understand_all_mistakes_ (3).pdf | 2023-11-29 15:52 | 2.9M | |
![[ ]](/icons/layout.gif) | Listening_answers_with_tapescrips_to_understand_all_mistakes_ (2).pdf | 2023-11-29 15:52 | 2.7M | |
![[ ]](/icons/layout.gif) | Listening_answers_with_tapescrips_to_understand_all_mistakes_ (1).pdf | 2023-11-29 15:52 | 2.7M | |
![[ ]](/icons/layout.gif) | Listening_Task_for_IELTS_students_pagenumbered_watermarked_watermarked.pdf | 2023-11-29 15:51 | 781K | |
![[ ]](/icons/layout.gif) | Listening_Task_for_IELTS_students_Made_by_Shaxzod_and_Firuza_.pdf | 2023-11-29 15:51 | 827K | |
![[ ]](/icons/layout.gif) | Listening Vocabulary.pdf | 2023-11-15 10:14 | 755K | |
![[ ]](/icons/layout.gif) | Listening Test 5.pdf | 2023-11-30 15:47 | 367K | |
![[ ]](/icons/layout.gif) | Listening Test.pdf | 2023-11-30 15:46 | 1.6M | |
![[ ]](/icons/layout.gif) | Listening Task .pdf | 2023-11-29 15:51 | 630K | |
![[ ]](/icons/layout.gif) | Listening Strategies for the IELTS Test.pdf | 2023-11-29 16:00 | 5.9M | |
![[ ]](/icons/layout.gif) | Listening Strategies For The IELTS.pdf | 2023-11-29 16:00 | 5.9M | |
![[ ]](/icons/layout.gif) | ListeningNumbers_cambridgeIELTSbooks.pdf | 2023-11-15 10:12 | 877K | |
![[ ]](/icons/layout.gif) | Listening Mock Test 3.pdf | 2023-11-29 15:52 | 503K | |
![[ ]](/icons/layout.gif) | Listening Mock Test 2.pdf | 2023-11-29 15:52 | 421K | |
![[ ]](/icons/layout.gif) | Listening Mock Test 1.pdf | 2023-11-29 15:52 | 582K | |
![[ ]](/icons/layout.gif) | Listening Audioscrips for understanding your mistakes .pdf | 2023-11-29 15:52 | 2.2M | |
![[ ]](/icons/layout.gif) | Listening Audioscrips for Mock test1.pdf | 2023-11-29 15:51 | 2.6M | |
![[ ]](/icons/layout.gif) | Listening Audioscrips for Mock test .pdf | 2023-11-29 15:51 | 2.6M | |
![[ ]](/icons/layout.gif) | Listening Audioscrip for understanding your Listening task -.pdf | 2023-11-29 15:51 | 2.2M | |
![[ ]](/icons/layout.gif) | Listening Audioscrip for understanding your Listening task - (1).pdf | 2023-11-29 15:51 | 2.2M | |
![[ ]](/icons/layout.gif) | Listening-test-46.pdf | 2023-11-30 15:46 | 162K | |
![[ ]](/icons/layout.gif) | Lingvist (ilmiy maqolalar to'plami).pdf | 2023-10-31 11:41 | 4.7M | |
![[ ]](/icons/layout.gif) | Line Graph Zafar Sobitov.pdf | 2023-11-29 14:09 | 1.8M | |
![[ ]](/icons/layout.gif) | Lifestorming Creating Meaning Marshall Goldsmith.pdf | 2023-11-06 09:43 | 2.6M | |
![[ ]](/icons/layout.gif) | Lesson for IELTS advanced Writing.pdf | 2023-11-29 12:30 | 23M | |
![[ ]](/icons/layout.gif) | Leaving Time_ Jodi Picoult.pdf | 2023-11-13 09:51 | 1.4M | |
![[ ]](/icons/layout.gif) | Learn to write better academic essays.pdf | 2023-11-29 15:51 | 5.5M | |
![[ ]](/icons/layout.gif) | Learning the Law by WILLIAMS, Glanville.pdf | 2023-11-10 11:18 | 256M | |
![[ ]](/icons/layout.gif) | Learning 800 Chinese Characters.pdf | 2023-11-06 16:21 | 23M | |
![[ ]](/icons/layout.gif) | Language_and_Law_The_Role_of_Language_and_Translation_in_EU_Competition.pdf | 2023-11-02 11:17 | 4.7M | |
![[ ]](/icons/layout.gif) | Language Learner.pdf | 2023-11-02 11:18 | 88M | |
![[ ]](/icons/layout.gif) | Kurs kitayskogo yazika_1_1.pdf | 2023-11-07 10:55 | 7.6M | |
![[ ]](/icons/layout.gif) | Kurs_kitayskogo_yazyka_2-2_rus.pdf | 2023-11-06 16:18 | 36M | |
![[ ]](/icons/layout.gif) | Kurs_kitayskogo_yazyka_2-1_rus.pdf | 2023-11-06 16:18 | 39M | |
![[ ]](/icons/layout.gif) | Koreys tili.pdf | 2023-11-02 09:48 | 104M | |
![[ ]](/icons/layout.gif) | Koreyski 1.pdf | 2023-11-02 09:50 | 135M | |
![[ ]](/icons/layout.gif) | Korean for Learners.pdf | 2023-11-02 09:50 | 78M | |
![[ ]](/icons/layout.gif) | Korean for Intermediate Learners1.pdf | 2023-11-02 09:48 | 9.4M | |
![[ ]](/icons/layout.gif) | Kitayskie_skazki.pdf | 2023-11-07 10:51 | 8.0M | |
![[ ]](/icons/layout.gif) | Key words Zafar Sobitov.pdf | 2023-11-29 14:09 | 787K | |
![[ ]](/icons/layout.gif) | Keith Speaking Academy Handicrafts.pdf | 2023-11-15 10:12 | 457K | |
![[ ]](/icons/layout.gif) | Keith Speaking Academy Crime - Lesson.pdf | 2023-11-15 10:11 | 801K | |
![[ ]](/icons/layout.gif) | Keith Speaking Academy - Studying.pdf | 2023-11-15 09:57 | 808K | |
![[ ]](/icons/layout.gif) | Kanchan_suyash_smart_students_guide_to_ideas_for_ielts_writi.pdf | 2023-11-30 15:46 | 544K | |
![[ ]](/icons/layout.gif) | Japanese_Hiragana_and_Katakana_Learn_the_Two_Japanese_Alphabets.pdf | 2023-11-13 09:51 | 3.1M | |
![[ ]](/icons/layout.gif) | Jahon tarix 10-sinf.pdf | 2023-11-21 11:45 | 3.5M | |
![[ ]](/icons/layout.gif) | Jahon tarix 8-sinf.pdf | 2023-11-21 11:45 | 3.8M | |
![[ ]](/icons/layout.gif) | Jahon tarix 7-sinf.pdf | 2023-11-21 11:45 | 3.8M | |
![[ ]](/icons/layout.gif) | Intercultural_communication_an_advanced_resource_book.pdf | 2022-10-28 03:21 | 2.0M | |
![[ ]](/icons/layout.gif) | Inter-culturul communication an advansed resourse book.pdf | 2023-10-27 09:22 | 2.0M | |
![[ ]](/icons/layout.gif) | Inter-cultural communication. A.Holliday.pdf | 2023-11-22 11:34 | 2.0M | |
![[ ]](/icons/layout.gif) | Intensive english by booknomy.pdf | 2023-11-20 12:11 | 212M | |
![[ ]](/icons/layout.gif) | Intensive IELTS Speaking.pdf | 2023-11-15 10:14 | 25M | |
![[ ]](/icons/layout.gif) | Intelligence.pdf | 2023-11-15 10:11 | 324K | |
![[ ]](/icons/layout.gif) | Inside writing 2.pdf | 2023-11-02 09:46 | 71M | |
![[ ]](/icons/layout.gif) | Inside Reading The academic word list in context Instructor's Pack.pdf | 2023-11-28 17:27 | 9.0M | |
![[ ]](/icons/layout.gif) | Inside Reading 3 Student Book.pdf | 2023-11-28 17:32 | 72M | |
![[ ]](/icons/layout.gif) | Inside Reading 2 Student Book.pdf | 2023-11-28 17:31 | 67M | |
![[ ]](/icons/layout.gif) | Inside Reading 2.pdf | 2023-11-02 09:51 | 101M | |
![[DIR]](/icons/folder.gif) | Inside Reading 1 Audio&Book/ | 2024-01-03 13:19 | - | |
![[ ]](/icons/layout.gif) | Inside Listening and Speaking 3.pdf | 2023-11-02 09:45 | 67M | |
![[ ]](/icons/layout.gif) | Insho qanday yoziladi. O.Madaev.pdf | 2023-10-30 16:46 | 2.5M | |
![[ ]](/icons/layout.gif) | Ingliz tilini mustaqil o'rganish uchun qo'llanma.pdf | 2023-11-29 16:00 | 19M | |
![[ ]](/icons/layout.gif) | Ingliz tili metodika 6.pdf | 2023-11-21 11:47 | 763K | |
![[ ]](/icons/layout.gif) | Ingliz tili grammatikasi (M.G'apporov, R.Qosimova).pdf | 2023-11-22 10:04 | 1.5M | |
![[ ]](/icons/layout.gif) | Ingliz tili gramatikasidan universal qo`llanma.pdf | 2023-11-17 10:36 | 9.3M | |
![[ ]](/icons/layout.gif) | Ingliz tilida grammatik va leksik.pdf | 2023-11-27 15:48 | 9.7M | |
![[ ]](/icons/layout.gif) | Ingliz tili 7 darslik.pdf | 2023-11-15 10:21 | 2.7M | |
![[ ]](/icons/layout.gif) | Ingliz tili.pdf | 2023-11-27 15:49 | 12M | |
![[ ]](/icons/layout.gif) | Ingliz tili (L.Xo'jayeva, D.Arziyeva va b.).pdf | 2023-11-22 10:04 | 2.1M | |
![[ ]](/icons/layout.gif) | Inglizcha-o_zbekcha.pdf | 2023-11-21 11:44 | 17M | |
![[ ]](/icons/layout.gif) | Inglizcha-o'zbekcha lug'at.pdf | 2023-11-13 15:19 | 17M | |
![[ ]](/icons/layout.gif) | Ingliz_tili_grammatikasi.pdf | 2023-11-20 17:52 | 1.2M | |
![[ ]](/icons/layout.gif) | Ingliz_tili_daftar_4_uzb.pdf | 2023-11-15 10:21 | 15M | |
![[ ]](/icons/layout.gif) | Ingliz_tili_4_uzb.pdf | 2023-11-15 10:21 | 15M | |
![[ ]](/icons/layout.gif) | Ingliz_tili_3_uzb.pdf | 2023-11-15 10:21 | 31M | |
![[ ]](/icons/layout.gif) | Ingliz_tili.pdf | 2023-11-20 17:52 | 1.6M | |
![[ ]](/icons/layout.gif) | Infinitive & Gerund.pdf | 2023-11-29 15:53 | 626K | |
![[ ]](/icons/layout.gif) | Improve_Your_Communication_Skills_Present_with_Confidence;_Write.pdf | 2023-11-22 11:26 | 1.6M | |
![[ ]](/icons/layout.gif) | Idioms database from Destination C1-C2.pdf | 2023-11-15 10:14 | 518K | |
![[ ]](/icons/layout.gif) | Idioms and Phrasal Verbs Intermediate.pdf | 2020-05-28 22:06 | 18M | |
![[ ]](/icons/layout.gif) | Idioms and Phrasal Verbs. Advanced.pdf | 2020-05-28 22:09 | 150M | |
![[ ]](/icons/layout.gif) | Idioms_For_IELTS_Speaking_by_Rachel.pdf | 2023-11-29 15:56 | 1.6M | |
![[ ]](/icons/layout.gif) | Idioms_For_IELTS_Speaking_by_Rachel (1).pdf | 2023-11-29 15:55 | 1.6M | |
![[ ]](/icons/layout.gif) | Identity-Based+Habits.pdf | 2023-11-15 10:13 | 25K | |
![[ ]](/icons/layout.gif) | Ideas for IELTS topicsa.pdf | 2023-11-15 10:13 | 296K | |
![[ ]](/icons/layout.gif) | Ideas for IELTS Topics.pdf | 2023-11-29 15:55 | 451K | |
![[ ]](/icons/layout.gif) | Ideas_for_IELTS_Topics_Ideas_Opinions_an_200519182839.pdf | 2023-11-29 15:55 | 2.1M | |
![[ ]](/icons/layout.gif) | Ideas.for.IELTS.Topics.pdf | 2023-11-15 09:55 | 412K | |
![[ ]](/icons/layout.gif) | IR3 Instructor_s Pack.pdf | 2023-11-28 17:25 | 14M | |
![[ ]](/icons/layout.gif) | IMPORTANT_TASK_1_smith_adam_edi_ielts_writing_task_1_academic_module.pdf | 2023-11-30 15:46 | 4.1M | |
![[ ]](/icons/layout.gif) | IELTS writing task 2.pdf | 2023-11-30 15:44 | 168K | |
![[ ]](/icons/layout.gif) | IELTS task 2 guide.pdf | 2023-11-29 15:55 | 973K | |
![[ ]](/icons/layout.gif) | IELTS synonyms.pdf | 2023-11-29 15:58 | 2.8M | |
![[ ]](/icons/layout.gif) | IELTS speaking part 2+3.pdf | 2023-11-29 15:52 | 1.0M | |
![[ ]](/icons/layout.gif) | IELTS listening Best preparation MrNiner.pdf | 2023-11-29 16:02 | 36M | |
![[ ]](/icons/unknown.gif) | IELTS journal.Pdf | 2023-11-29 15:53 | 312K | |
![[ ]](/icons/layout.gif) | IELTSfever-ac-reading-test-1.pdf | 2023-11-29 16:00 | 8.3M | |
![[ ]](/icons/layout.gif) | IELTS diagram guide.pdf | 2023-11-20 12:09 | 2.5M | |
![[ ]](/icons/layout.gif) | IELTS_speaking_actual_tests_and_suggested_answers_january_ap.pdf | 2023-11-06 10:09 | 2.2M | |
![[ ]](/icons/layout.gif) | IELTS_simon_ielts_writing_task_1.pdf | 2023-11-28 17:23 | 2.7M | |
![[ ]](/icons/layout.gif) | IELTS_selfprep_writing.pdf | 2023-11-14 11:32 | 400K | |
![[ ]](/icons/layout.gif) | IELTS_progress-ielts-reading-answer-sheet.pdf | 2023-11-15 10:13 | 60K | |
![[ ]](/icons/layout.gif) | IELTS_for_Academic.pdf | 2023-11-15 10:17 | 39M | |
![[ ]](/icons/layout.gif) | IELTS_book-reading_and_writing.pdf | 2023-11-29 10:49 | 30M | |
![[ ]](/icons/layout.gif) | IELTS_Writing_band_9_essaysSmart_bruce_a.pdf | 2023-11-14 11:32 | 3.9M | |
![[ ]](/icons/layout.gif) | IELTS_Writing_Task_2_Samples.pdf | 2023-11-13 15:20 | 3.5M | |
![[ ]](/icons/layout.gif) | IELTS_Vocabulary_pdf_2000_words_to_score_7_–_8_in_IELTS_exam_IELTS.pdf | 2023-11-28 17:24 | 1.5M | |
![[ ]](/icons/layout.gif) | IELTS_Success_Formula_General__The.pdf | 2023-11-28 17:25 | 16M | |
![[ ]](/icons/layout.gif) | IELTS_Speaking_Strategies.pdf | 2023-11-29 14:08 | 1.3M | |
![[ ]](/icons/layout.gif) | IELTS_Simon_Writing_Task1_Academic.pdf | 2023-11-15 09:54 | 91K | |
![[ ]](/icons/layout.gif) | IELTS_Simon_Speaking_Describe_your.pdf | 2023-11-29 14:09 | 81K | |
![[ ]](/icons/layout.gif) | IELTS_Reading_Texts__Essential_Practice.pdf | 2023-11-28 17:24 | 1.9M | |
![[ ]](/icons/layout.gif) | IELTS_Reading_Texts__Essential_Practice (1).pdf | 2023-11-28 17:24 | 1.9M | |
![[ ]](/icons/layout.gif) | IELTS_Reading_Answer_Sheet.pdf | 2023-11-28 17:23 | 127K | |
![[ ]](/icons/layout.gif) | IELTS_Listening_Answer_Sheet.pdf | 2023-11-28 17:23 | 228K | |
![[ ]](/icons/layout.gif) | IELTS_Listening_Actual_Test_Vol.pdf | 2023-11-29 15:55 | 25M | |
![[ ]](/icons/layout.gif) | IELTS_Advantage_Writing_Skills.pdf | 2023-11-15 10:15 | 71M | |
![[ ]](/icons/layout.gif) | IELTS_Academic_Writing_Task_2_May_Aug_2022_.pdf | 2023-11-30 15:46 | 3.5M | |
![[ ]](/icons/layout.gif) | IELTS_Academic_Writing_Task_1_May_Aug_2022_.pdf | 2023-11-29 16:00 | 5.0M | |
![[ ]](/icons/layout.gif) | IELTS_Academic_Vocabulary_by_Rachel.pdf | 2023-11-29 15:56 | 2.5M | |
![[ ]](/icons/layout.gif) | IELTS_Academic_Vocabulary.pdf | 2023-11-29 15:55 | 3.0M | |
![[ ]](/icons/layout.gif) | IELTS_Academic_&_General_Task_2_How_to_Write_at_a_Band_9_Level_PDFDrive.pdf | 2023-11-09 16:52 | 1.3M | |
![[ ]](/icons/layout.gif) | IELTS Writing Task 2 - Sample Response 7.pdf | 2023-11-29 15:57 | 2.6M | |
![[ ]](/icons/layout.gif) | IELTS Writing Task 1 (Simon).pdf | 2023-11-13 12:05 | 5.3M | |
![[ ]](/icons/layout.gif) | IELTS Writing 2_Band 8.0 Sample Argumentative Essay.pdf | 2023-11-29 10:36 | 210K | |
![[ ]](/icons/layout.gif) | IELTS Vocabulary Masterclass Book 2 PDF by IELTSXpress.pdf | 2023-11-30 15:46 | 1.5M | |
![[ ]](/icons/layout.gif) | IELTS Vocabulary C1-C2.pdf | 2023-11-29 15:51 | 21M | |
![[ ]](/icons/layout.gif) | IELTS Vocabulary Booster.pdf | 2023-11-30 15:46 | 4.0M | |
![[DIR]](/icons/folder.gif) | IELTS Trainer CD and Book/ | 2024-01-03 13:18 | - | |
![[DIR]](/icons/folder.gif) | IELTS Trainer 2 Audio and Book/ | 2024-01-03 13:18 | - | |
![[ ]](/icons/layout.gif) | IELTS Trainer 2.pdf | 2023-11-30 15:47 | 17M | |
![[DIR]](/icons/folder.gif) | IELTS Testbuilder2 audios and book/ | 2024-01-03 13:18 | - | |
![[ ]](/icons/layout.gif) | IELTS Special Journal 2.pdf | 2023-11-29 16:00 | 6.3M | |
![[ ]](/icons/layout.gif) | IELTS Speaking part 2 +3.pdf | 2023-11-29 14:09 | 1.0M | |
![[ ]](/icons/layout.gif) | IELTS Speaking by jeremy chiron.pdf | 2023-11-29 16:08 | 299M | |
![[ ]](/icons/layout.gif) | IELTS Speaking and Vocabulary PDF BO.pdf | 2023-11-29 14:08 | 3.5M | |
![[ ]](/icons/layout.gif) | IELTS Speaking and Vocabulary.pdf | 2023-11-15 10:15 | 2.2M | |
![[ ]](/icons/layout.gif) | IELTS Speaking Topics.pdf | 2023-11-29 12:33 | 90M | |
![[ ]](/icons/layout.gif) | IELTS Speaking Masterclass Pro.pdf | 2023-11-29 14:08 | 706K | |
![[ ]](/icons/layout.gif) | IELTS Speaking Masterclass.pdf | 2023-11-29 15:55 | 706K | |
![[ ]](/icons/layout.gif) | IELTS Sample Essays Collection.pdf | 2023-11-29 15:58 | 3.3M | |
![[ ]](/icons/layout.gif) | IELTS SPEAKING NICE VOCABULARY.pdf | 2023-11-30 15:47 | 899K | |
![[ ]](/icons/layout.gif) | IELTS Reading for Mock test .pdf | 2023-11-29 14:09 | 202K | |
![[ ]](/icons/layout.gif) | IELTS Reading Texts Book 2021-2022.pdf | 2023-11-29 15:51 | 2.3M | |
![[ ]](/icons/layout.gif) | IELTS Reading Recent actual tests Vo.pdf | 2023-11-29 16:05 | 74M | |
![[ ]](/icons/layout.gif) | IELTS Reading Recent Actual tests Vo1.pdf | 2023-11-29 16:05 | 76M | |
![[ ]](/icons/layout.gif) | IELTS Reading Recent Actual Tests with Answer Key.pdf | 2023-11-29 15:55 | 1.6M | |
![[ ]](/icons/layout.gif) | IELTS Reading Recent Actual Tests Vol 6.pdf | 2023-11-29 14:19 | 98M | |
![[ ]](/icons/layout.gif) | IELTS Reading Recent Actual Tests Vol 5.pdf | 2023-11-29 14:14 | 41M | |
![[ ]](/icons/layout.gif) | IELTS Reading Recent Actual Tests Vol 4.pdf | 2023-11-29 14:18 | 74M | |
![[ ]](/icons/layout.gif) | IELTS Reading Recent Actual Tests Vol 2.pdf | 2023-11-29 14:16 | 108M | |
![[ ]](/icons/layout.gif) | IELTS Reading Recent Actual Tests Vol 1.pdf | 2023-11-29 14:18 | 77M | |
![[ ]](/icons/layout.gif) | IELTS Reading Actual tests Volume 3.pdf | 2023-11-29 16:03 | 106M | |
![[ ]](/icons/layout.gif) | IELTS READING STRATEGIES.pdf | 2023-11-29 15:56 | 1.7M | |
![[ ]](/icons/layout.gif) | IELTS Practice Tests Plus 3.pdf | 2023-11-15 10:14 | 62M | |
![[ ]](/icons/layout.gif) | IELTS Practice Tests Plus 1.pdf | 2023-11-29 16:04 | 59M | |
![[ ]](/icons/layout.gif) | IELTS Practice Test plus 2.pdf | 2023-11-29 15:56 | 6.6M | |
![[DIR]](/icons/folder.gif) | IELTS Practice Test plus 1/ | 2024-01-03 13:15 | - | |
![[ ]](/icons/layout.gif) | IELTS Mock exam overall.pdf | 2023-11-29 14:09 | 276K | |
![[ ]](/icons/layout.gif) | IELTS Listening for Mock test.pdf | 2023-11-29 14:09 | 127K | |
![[ ]](/icons/layout.gif) | IELTS Listening for Mock test .pdf | 2023-11-29 14:09 | 925K | |
![[ ]](/icons/layout.gif) | IELTS Listening Tests - Section 2 (with answers).pdf | 2023-11-15 09:55 | 5.8M | |
![[ ]](/icons/layout.gif) | IELTS Journal 7+ tips for Speaking.pdf | 2023-11-15 10:13 | 447K | |
![[ ]](/icons/layout.gif) | IELTS Journal 7+ ideas for IELTS topics.pdf | 2023-11-15 10:14 | 312K | |
![[ ]](/icons/layout.gif) | IELTS Journal - Tips for IELTS Reading_Answer.pdf | 2023-11-28 17:23 | 89K | |
![[ ]](/icons/layout.gif) | IELTS Journal - Tips for IELTS Reading.pdf | 2023-11-28 17:23 | 916K | |
![[ ]](/icons/layout.gif) | IELTS Journal - Task 2.pdf | 2023-11-15 09:56 | 2.4M | |
![[ ]](/icons/layout.gif) | IELTS Journal - Task 1.pdf | 2023-11-15 09:56 | 6.0M | |
![[ ]](/icons/layout.gif) | IELTS Journal - Speaking.pdf | 2023-11-15 09:56 | 2.2M | |
![[ ]](/icons/layout.gif) | IELTS Journal - Reading.pdf | 2023-11-15 09:56 | 2.7M | |
![[ ]](/icons/layout.gif) | IELTS Journal - Ideas.pdf | 2023-11-15 09:56 | 2.1M | |
![[ ]](/icons/layout.gif) | IELTSFever-ac-reading-test-9.pdf | 2023-11-29 16:00 | 8.5M | |
![[ ]](/icons/layout.gif) | IELTS Band Up.pdf | 2023-11-29 15:59 | 4.0M | |
![[ ]](/icons/layout.gif) | IELTS All Speaking Topics and Sample Answers.pdf | 2023-11-29 16:00 | 12M | |
![[ ]](/icons/layout.gif) | IELTS Advantage Writing Skills.pdf | 2023-11-13 12:09 | 71M | |
![[ ]](/icons/layout.gif) | IELTS Advantage - Writing Skills (ORG).pdf | 2023-11-20 12:09 | 71M | |
![[ ]](/icons/layout.gif) | IELTS Advantage - Reading Skills.pdf | 2023-11-29 14:18 | 76M | |
![[ ]](/icons/layout.gif) | IELTS Actaul Listening Oct-Jan 2021 2022.pdf | 2023-11-30 15:47 | 4.5M | |
![[ ]](/icons/layout.gif) | IELTS Academic Writing Task 2 (Simon).pdf | 2023-11-13 12:05 | 775K | |
![[ ]](/icons/layout.gif) | IELTS 4000 Academic Word List_.pdf | 2023-11-29 15:51 | 1.1M | |
![[ ]](/icons/layout.gif) | IELTS 8.5+ sirlari.pdf | 2023-11-29 15:55 | 2.3M | |
![[ ]](/icons/layout.gif) | IELTS.Academic.Writing.Task.2 [britishcouncilofficial].pdf | 2023-11-15 09:55 | 775K | |
![[ ]](/icons/layout.gif) | IELTS-writing-answer-sheet.pdf | 2023-11-15 10:13 | 1.1M | |
![[ ]](/icons/layout.gif) | IELTS-speaking-study-planner-January-April-2023.pdf | 2023-11-29 15:55 | 1.0M | |
![[ ]](/icons/layout.gif) | IELTS-information-for-candidates-english-us.pdf | 2023-11-15 10:18 | 681K | |
![[ ]](/icons/layout.gif) | IELTS-Writing-Maximiser.pdf | 2023-11-30 15:50 | 56M | |
![[ ]](/icons/layout.gif) | IELTS-Trainer.pdf | 2023-11-13 12:10 | 60M | |
![[ ]](/icons/layout.gif) | IELTS-Speaking-Part-2-Topics-Tips-by-Simon @uzieltsbot.pdf | 2023-11-15 09:55 | 1.0M | |
![[ ]](/icons/layout.gif) | IELTS-Speaking-Jan-April-22.pdf | 2023-11-29 15:58 | 2.2M | |
![[ ]](/icons/layout.gif) | IELTS-Simon.pdf | 2023-11-29 15:54 | 312K | |
![[ ]](/icons/layout.gif) | IELTS-Simon-Writing-Task1-Academic-Table-worksheet-part5.pdf | 2023-11-28 17:23 | 227K | |
![[ ]](/icons/layout.gif) | IELTS-Simon-Reading-Which-paragraph-worksheet-part5.pdf | 2023-11-29 14:09 | 73K | |
![[ ]](/icons/layout.gif) | IELTS-Simon-Reading-Short-answers-worksheet-part8.pdf | 2023-11-29 14:09 | 51K | |
![[ ]](/icons/layout.gif) | IELTS-Simon-Reading-Sentence-endings-worksheet-part9.pdf | 2023-11-29 14:09 | 122K | |
![[ ]](/icons/layout.gif) | IELTS-Simon-Reading-Practice-exercise-3.pdf | 2023-11-29 14:09 | 57K | |
![[ ]](/icons/layout.gif) | IELTS-Simon-Reading-Multiple-Choice-Worksheet-part6.pdf | 2023-11-29 14:09 | 53K | |
![[ ]](/icons/layout.gif) | IELTS-Simon-Reading-Matching-names-worksheet-part7.pdf | 2023-11-29 14:09 | 58K | |
![[ ]](/icons/layout.gif) | IELTS-PRACTICE-TESTS.pdf | 2023-11-10 10:05 | 2.7M | |
![[ ]](/icons/layout.gif) | IELTS 📖Reading for Mock test.pdf | 2023-11-29 15:54 | 148K | |
![[ ]](/icons/layout.gif) | IELTS 📖Reading for Mock test .pdf | 2023-11-29 15:52 | 120K | |
![[ ]](/icons/layout.gif) | IELTS 🎧 Listening for Mock test.pdf | 2023-11-29 15:54 | 216K | |
![[ ]](/icons/layout.gif) | IELTS 🎧 Listening for Mock test .pdf | 2023-11-29 15:51 | 210K | |
![[ ]](/icons/layout.gif) | IELTS 🎧 Listening for Mock.pdf | 2023-11-29 15:52 | 205K | |
![[ ]](/icons/layout.gif) | IDP Guidelines on IELTS Writing.pdf | 2023-11-29 15:54 | 339K | |
![[ ]](/icons/layout.gif) | Human_behaviour_2'_English_mega_class!_30_minutes_of_new_vocabulary!.pdf | 2023-11-30 15:46 | 493K | |
![[ ]](/icons/layout.gif) | Hsk 3.pdf | 2023-11-06 16:18 | 845K | |
![[ ]](/icons/layout.gif) | Hsk 1 standard course.pdf | 2023-11-07 10:51 | 20M | |
![[ ]](/icons/layout.gif) | Hsk-3.pdf | 2023-11-07 10:52 | 36M | |
![[ ]](/icons/layout.gif) | How to write Great Essays.pdf | 2023-11-29 14:08 | 568K | |
![[ ]](/icons/layout.gif) | How to improve your reading speed - IELTS Juice.pdf | 2023-11-15 09:55 | 93K | |
![[ ]](/icons/layout.gif) | Hopkins_diane_cullen_pauline_cambridge_grammar_for_ielts_stu.pdf | 2023-11-20 11:49 | 78M | |
![[ ]](/icons/layout.gif) | Homevocabularylist.pdf | 2023-11-15 10:11 | 194K | |
![[ ]](/icons/layout.gif) | Headway Pronunciation.pdf | 2023-11-29 14:08 | 2.6M | |
![[ ]](/icons/layout.gif) | Headway Intermediate.pdf | 2023-11-13 12:12 | 35M | |
![[DIR]](/icons/folder.gif) | Headway 5th edition Beginner Audio & Book/ | 2024-01-03 13:07 | - | |
![[DIR]](/icons/folder.gif) | HeadWay Upper-Intermediate CD & Bookm/ | 2024-01-03 13:10 | - | |
![[DIR]](/icons/folder.gif) | HeadWay Pre-Intermediate CD/ | 2024-01-03 13:09 | - | |
![[DIR]](/icons/folder.gif) | HeadWay Intermediate CD/ | 2024-01-03 13:08 | - | |
![[DIR]](/icons/folder.gif) | HeadWay Elementary CD&Book/ | 2024-01-03 13:08 | - | |
![[DIR]](/icons/folder.gif) | HeadWay Advanced CD & Book/ | 2024-01-03 13:07 | - | |
![[ ]](/icons/layout.gif) | Hattingh_tian_ielts_7_writing_task_2.pdf | 2023-11-06 10:09 | 1.4M | |
![[ ]](/icons/layout.gif) | Hanyu kouyu sucheng.pdf | 2023-11-09 15:21 | 38M | |
![[ ]](/icons/layout.gif) | Hanyu Jiaocheng 3-1 - 2007.pdf | 2023-11-06 16:21 | 40M | |
![[ ]](/icons/layout.gif) | HSK six.pdf | 2023-11-07 10:52 | 5.5M | |
![[ ]](/icons/layout.gif) | HSK II - Word List.pdf | 2023-11-07 10:51 | 245K | |
![[ ]](/icons/layout.gif) | HSK I - Word List.pdf | 2023-11-07 10:51 | 152K | |
![[ ]](/icons/layout.gif) | HSK6_writing_comprehensive.pdf | 2023-11-09 15:22 | 6.5M | |
![[ ]](/icons/layout.gif) | HSK 6.pdf | 2023-11-07 10:55 | 2.6M | |
![[ ]](/icons/unknown.gif) | HSK6.PDF | 2023-11-09 15:21 | 711K | |
![[ ]](/icons/layout.gif) | HSK 6 上.pdf | 2023-11-07 10:52 | 13M | |
![[ ]](/icons/layout.gif) | HSK5 test_Say Ninhao.pdf | 2023-11-06 16:18 | 1.3M | |
![[ ]](/icons/layout.gif) | HSK5 UZB.pdf | 2023-11-07 10:55 | 1.4M | |
![[ ]](/icons/unknown.gif) | HSK5.PDF | 2023-11-09 15:21 | 494K | |
![[ ]](/icons/layout.gif) | HSK5词汇表.pdf | 2023-11-06 16:18 | 749K | |
![[ ]](/icons/layout.gif) | HSK 4 lugʻati oʻzbekcha.pdf | 2023-11-07 10:51 | 1.5M | |
![[ ]](/icons/unknown.gif) | HSK4.PDF | 2023-11-09 15:21 | 500K | |
![[ ]](/icons/layout.gif) | HSK 4 课文 2018-10-13 .pdf | 2023-11-07 10:51 | 12M | |
![[ ]](/icons/layout.gif) | HSK 3 standard course.pdf | 2023-11-09 15:21 | 36M | |
![[ ]](/icons/layout.gif) | HSK 3 Vocabulary list.pdf | 2023-11-07 10:51 | 520K | |
![[ ]](/icons/unknown.gif) | HSK3.PDF | 2023-11-09 15:21 | 604K | |
![[ ]](/icons/layout.gif) | HSK 2 Vocabulary list.pdf | 2023-11-07 10:51 | 308K | |
![[ ]](/icons/layout.gif) | HSK 2 Standard Course.pdf | 2023-11-09 15:21 | 27M | |
![[ ]](/icons/unknown.gif) | HSK2.PDF | 2023-11-09 15:21 | 705K | |
![[ ]](/icons/layout.gif) | HSK1WB.pdf | 2023-11-09 14:34 | 33M | |
![[ ]](/icons/layout.gif) | HSK 1 Standard Course ( PDFDrive.com ).pdf | 2023-10-26 16:53 | 20M | |
![[ ]](/icons/layout.gif) | HSK1SB.pdf | 2023-11-09 14:33 | 138M | |
![[ ]](/icons/unknown.gif) | HSK1.PDF | 2023-11-09 15:21 | 717K | |
![[ ]](/icons/layout.gif) | HSK-Standard-Course-4B-Workbook.pdf | 2023-11-07 10:51 | 34M | |
![[ ]](/icons/layout.gif) | HSK-Standard-Course-4A-Workbook.pdf | 2023-11-07 10:51 | 24M | |
![[ ]](/icons/layout.gif) | HSK-6-Vocabulary-list.pdf | 2023-11-06 16:18 | 2.7M | |
![[ ]](/icons/layout.gif) | HSK-6-SB-2.pdf | 2023-11-09 15:25 | 109M | |
![[ ]](/icons/layout.gif) | HSK-6-SB-1.pdf | 2023-11-09 15:24 | 100M | |
![[ ]](/icons/layout.gif) | HSK-6-Grammar-Points.pdf | 2023-11-09 15:21 | 331K | |
![[ ]](/icons/layout.gif) | HSK-5-Vocabulary-list.pdf | 2023-11-06 16:18 | 1.5M | |
![[ ]](/icons/layout.gif) | HSK-5-Verbs-331-360.pdf | 2023-11-06 16:18 | 149K | |
![[ ]](/icons/layout.gif) | HSK-5-Verbs-31-60.pdf | 2023-11-06 16:17 | 140K | |
![[ ]](/icons/layout.gif) | HSK-5-SB-2.pdf | 2023-11-09 15:23 | 86M | |
![[ ]](/icons/layout.gif) | HSK-5-SB-1.pdf | 2023-11-07 10:52 | 44M | |
![[ ]](/icons/layout.gif) | HSK-5-Grammar-Points-2.pdf | 2023-11-09 15:21 | 310K | |
![[DIR]](/icons/folder.gif) | HSK-5(下)WB2-AUDIO&WB/ | 2024-01-03 13:14 | - | |
![[DIR]](/icons/folder.gif) | HSK-5(下)SB2-AUDIO/ | 2024-01-03 13:14 | - | |
![[DIR]](/icons/folder.gif) | HSK-5(上)WB1-AUDIO/ | 2024-01-03 13:13 | - | |
![[DIR]](/icons/folder.gif) | HSK-5(上)SB1-AUDIO&WB/ | 2024-01-03 13:13 | - | |
![[ ]](/icons/layout.gif) | HSK-4 SB2.pdf | 2023-11-09 15:22 | 30M | |
![[ ]](/icons/layout.gif) | HSK-4 SB1.pdf | 2023-11-09 15:21 | 73M | |
![[ ]](/icons/layout.gif) | HSK-4.pdf | 2023-11-06 16:18 | 1.5M | |
![[ ]](/icons/layout.gif) | HSK-4-Grammar-Points-3.pdf | 2023-11-09 15:21 | 364K | |
![[ ]](/icons/layout.gif) | HSK-3-Grammar-Points-1.pdf | 2023-11-09 15:21 | 406K | |
![[ ]](/icons/layout.gif) | HSK-2-Grammar-Points.pdf | 2023-11-09 15:21 | 487K | |
![[ ]](/icons/layout.gif) | HSK-1-Grammar-Points.pdf | 2023-11-09 15:21 | 310K | |
![[ ]](/icons/layout.gif) | HSK+5下-Mandarin.com.pdf | 2023-11-06 16:19 | 24M | |
![[ ]](/icons/layout.gif) | HSK+5上-Mandarin.com.pdf | 2023-11-06 16:18 | 25M | |
![[ ]](/icons/layout.gif) | HSK标准课程-5级(上).pdf | 2023-11-07 10:52 | 48M | |
![[ ]](/icons/layout.gif) | HSK 六级 词汇.pdf | 2023-11-06 16:18 | 2.9M | |
![[DIR]](/icons/folder.gif) | H51331-听力-答案/ | 2024-01-03 13:06 | - | |
![[DIR]](/icons/folder.gif) | H51330 听力 答案/ | 2024-01-03 13:06 | - | |
![[DIR]](/icons/folder.gif) | H51329 听力 答案/ | 2024-01-03 13:06 | - | |
![[DIR]](/icons/folder.gif) | H51328 听力 答案/ | 2024-01-03 13:06 | - | |
![[DIR]](/icons/folder.gif) | H51327 听力 答案/ | 2024-01-03 13:06 | - | |
![[DIR]](/icons/folder.gif) | H51221-听力答案/ | 2024-01-03 13:06 | - | |
![[DIR]](/icons/folder.gif) | H51220-听力-答案/ | 2024-01-03 13:06 | - | |
![[DIR]](/icons/folder.gif) | H51219 听力 答案/ | 2024-01-03 13:06 | - | |
![[DIR]](/icons/folder.gif) | H51218 听力 答案/ | 2024-01-03 13:06 | - | |
![[DIR]](/icons/folder.gif) | H51111 听力 答案/ | 2024-01-03 13:06 | - | |
![[DIR]](/icons/folder.gif) | H51110 听力 答案/ | 2024-01-03 13:06 | - | |
![[DIR]](/icons/folder.gif) | H51009 听力 答案/ | 2024-01-03 13:06 | - | |
![[DIR]](/icons/folder.gif) | H51008 听力 答案/ | 2024-01-03 13:06 | - | |
![[DIR]](/icons/folder.gif) | H51007 听力 答案/ | 2024-01-03 13:05 | - | |
![[DIR]](/icons/folder.gif) | H51005 听力 答案/ | 2024-01-03 13:05 | - | |
![[DIR]](/icons/folder.gif) | H51004 听力 答案/ | 2024-01-03 13:05 | - | |
![[DIR]](/icons/folder.gif) | H51003 听力 答案/ | 2024-01-03 13:05 | - | |
![[DIR]](/icons/folder.gif) | H51002-听力-答案/ | 2024-01-03 13:05 | - | |
![[DIR]](/icons/folder.gif) | H51001-听力-答案/ | 2024-01-03 13:05 | - | |
![[DIR]](/icons/folder.gif) | H50000-听力-答案/ | 2024-01-03 13:05 | - | |
![[DIR]](/icons/folder.gif) | H41332 答案/ | 2024-01-03 13:05 | - | |
![[DIR]](/icons/folder.gif) | H41330 答案/ | 2024-01-03 13:05 | - | |
![[DIR]](/icons/folder.gif) | H41329 答案/ | 2024-01-03 13:05 | - | |
![[DIR]](/icons/folder.gif) | H41328 答案/ | 2024-01-03 13:05 | - | |
![[DIR]](/icons/folder.gif) | H41327 答案/ | 2024-01-03 13:05 | - | |
![[DIR]](/icons/folder.gif) | H41221 听力 答案/ | 2024-01-03 13:05 | - | |
![[ ]](/icons/layout.gif) | H41220.pdf | 2023-11-08 14:13 | 1.4M | |
![[ ]](/icons/layout.gif) | H11003.pdf | 2023-11-06 16:18 | 464K | |
![[ ]](/icons/layout.gif) | Great Britain History.pdf | 2023-10-26 16:16 | 1.8M | |
![[ ]](/icons/layout.gif) | Grammarway 4 with answers.pdf | 2023-11-15 10:20 | 30M | |
![[ ]](/icons/layout.gif) | Grammarway 4.pdf | 2023-11-15 10:16 | 30M | |
![[ ]](/icons/layout.gif) | Grammarway 3 with answers.pdf | 2023-11-15 10:21 | 41M | |
![[ ]](/icons/layout.gif) | Grammarway 3.pdf | 2023-11-15 10:17 | 41M | |
![[ ]](/icons/layout.gif) | Grammarway 2 with answers.pdf | 2023-11-15 10:21 | 26M | |
![[ ]](/icons/layout.gif) | Grammarway 2.pdf | 2023-11-13 12:18 | 39M | |
![[ ]](/icons/layout.gif) | Grammarway 1 with answers.pdf | 2023-11-15 10:21 | 30M | |
![[ ]](/icons/layout.gif) | Grammarway 1.pdf | 2023-11-15 10:15 | 13M | |
![[ ]](/icons/layout.gif) | Grammarway-4.pdf | 2023-11-13 12:17 | 11M | |
![[ ]](/icons/layout.gif) | Grammarway-1.pdf | 2023-11-13 12:17 | 13M | |
![[ ]](/icons/layout.gif) | Grammar for IELTS WRITING.pdf | 2023-11-15 09:55 | 536K | |
![[ ]](/icons/layout.gif) | Grammar and Language Workbook_ Grade 6 ( PDFDrive ).pdf | 2023-11-13 15:19 | 1.6M | |
![[ ]](/icons/layout.gif) | Grammar Based Conversation Questions Book.pdf | 2023-11-29 15:54 | 448K | |
![[ ]](/icons/layout.gif) | Gramatika_inglizcha.pdf | 2023-11-29 14:08 | 201K | |
![[ ]](/icons/layout.gif) | Get_ielts_band_9_in_writing_task_1.pdf | 2023-11-29 15:56 | 1.9M | |
![[ ]](/icons/layout.gif) | Gerund jadvali English_with_Adik.pdf | 2023-11-29 15:54 | 215K | |
![[ ]](/icons/layout.gif) | Gateway-B2-Students-book.pdf | 2023-11-22 09:59 | 91M | |
![[ ]](/icons/layout.gif) | Games_People_Play_The_Psychology_of_Human_Relationships_by_Eric.pdf | 2023-10-27 17:11 | 590K | |
![[DIR]](/icons/folder.gif) | Fundamentals of English Grammar 4th-Betty Azar_CDs&WB/ | 2024-01-03 13:04 | - | |
![[DIR]](/icons/folder.gif) | Fundamentals_of_English_Grammar_4th_Betty_Azar_Teacher_Resource with WorkBook/ | 2024-01-03 13:04 | - | |
![[ ]](/icons/layout.gif) | Full Practise test.pdf | 2023-11-29 14:08 | 2.0M | |
![[ ]](/icons/layout.gif) | Full MOCK(level B1)(Coach_Ali_Sher).pdf | 2023-11-30 15:47 | 421K | |
![[ ]](/icons/layout.gif) | Frequently misspelt words Pauline Cullen.pdf | 2023-11-15 10:12 | 36K | |
![[ ]](/icons/layout.gif) | Free_Talk_Hand_Book.pdf | 2023-11-29 15:56 | 2.3M | |
![[ ]](/icons/layout.gif) | Fransuz tili darsligi (R.Shirinova, F.Muhamedaminova).pdf | 2023-11-22 10:04 | 11M | |
![[ ]](/icons/layout.gif) | Fransuz tili darsligi (D.Aliqulova, D.Jo'raboyeva).pdf | 2023-11-22 10:04 | 9.0M | |
![[ ]](/icons/layout.gif) | Fransuz tilidan 14 ta dars (S.Yoqubova, O.Po'latova).pdf | 2023-11-22 10:04 | 7.9M | |
![[ ]](/icons/layout.gif) | Fransuz tili 7.pdf | 2023-11-15 10:20 | 6.6M | |
![[ ]](/icons/layout.gif) | Fransuz tili 6.pdf | 2023-11-21 11:46 | 48M | |
![[ ]](/icons/layout.gif) | Fransuz_tili_daftar_4_uzb.pdf | 2023-11-15 10:21 | 21M | |
![[ ]](/icons/layout.gif) | Fransuz_tili_daftar_3_uzb.pdf | 2023-11-15 10:20 | 7.6M | |
![[ ]](/icons/layout.gif) | Fransuz_tili_3_uzb.pdf | 2023-11-15 10:20 | 27M | |
![[ ]](/icons/layout.gif) | Francais_III_L_Abdushukurova,_R_Abulxanova,_Z_Aytuganova,_H_Ibragimov.pdf | 2023-11-22 10:04 | 2.7M | |
![[ ]](/icons/layout.gif) | Francais II (J.Yakubov, Z.Davronova).pdf | 2023-11-22 10:04 | 2.3M | |
![[ ]](/icons/layout.gif) | Francais I (M.Ubaydullayev, O.Saxno, E.Xudoyberganova).pdf | 2023-11-22 10:04 | 10M | |
![[ ]](/icons/layout.gif) | Foundation IELTS Masterclass. Teacher's pack.pdf | 2023-11-02 11:21 | 9.3M | |
![[ ]](/icons/layout.gif) | Foundation IELTS Masterclass. Student's book.pdf | 2023-11-02 11:21 | 27M | |
![[ ]](/icons/layout.gif) | Fors tili (Malik Abdusamatov).pdf | 2023-11-22 10:04 | 12M | |
![[ ]](/icons/layout.gif) | Foreign Language. Hadjikulova Sh.N. darslik. 2022.pdf | 2023-11-30 15:49 | 13M | |
![[ ]](/icons/layout.gif) | Fire and ice.pdf | 2023-11-30 15:47 | 136K | |
![[ ]](/icons/layout.gif) | Filologiya masalalari yosh tagqiqotchilar nigohida.1-qism.pdf | 2023-10-31 11:20 | 57M | |
![[ ]](/icons/layout.gif) | Filologiya_masalalari_yosh_tadqiqotchilari_nigohida_1_ilmiy_amaliy.pdf | 2023-10-30 15:14 | 109M | |
![[ ]](/icons/layout.gif) | Filalogiya ta'lim masalalari Begimqulov U. (1).pdf | 2023-10-31 11:19 | 47M | |
![[ ]](/icons/layout.gif) | Feedback by Pauline Cullen.pdf | 2023-11-15 10:12 | 99K | |
![[ ]](/icons/layout.gif) | Faye-Lynn_Wu_-_My_First_Book_of_Chinese_Words.pdf | 2023-11-06 16:18 | 7.7M | |
![[ ]](/icons/layout.gif) | Ezequiel Teodoro. El Manuscrito. De Avicena..pdf | 2023-11-09 15:35 | 6.5M | |
![[ ]](/icons/layout.gif) | Explained answers.pdf | 2023-11-29 10:36 | 5.1M | |
![[ ]](/icons/layout.gif) | Exactly_What_to_Say_The_Magic_Words_for_Influence_and_Impact_by.pdf | 2023-10-27 17:11 | 1.1M | |
![[ ]](/icons/layout.gif) | Everyday Idioms.pdf | 2023-11-28 17:27 | 8.8M | |
![[ ]](/icons/layout.gif) | Essentials of Linguistics.pdf | 2023-11-22 11:34 | 3.5M | |
![[ ]](/icons/layout.gif) | Essentials-of-Linguistics.pdf | 2023-11-22 11:27 | 3.5M | |
![[ ]](/icons/layout.gif) | Essential reading for IELTS.pdf | 2023-11-30 15:50 | 49M | |
![[ ]](/icons/layout.gif) | Essential_Mandarin_Chinese_Grammar.pdf | 2023-11-09 15:22 | 7.2M | |
![[DIR]](/icons/folder.gif) | Essential Words for the TOEIC test/ | 2024-01-03 13:03 | - | |
![[ ]](/icons/layout.gif) | Essential Words 4.pdf | 2023-11-06 16:07 | 10M | |
![[ ]](/icons/layout.gif) | Essential Words 1.pdf | 2023-11-06 16:07 | 9.3M | |
![[DIR]](/icons/folder.gif) | Essential Tests for IELTS CDs/ | 2024-01-03 13:03 | - | |
![[ ]](/icons/layout.gif) | Essential Tests for IELTS.pdf | 2023-11-28 17:29 | 43M | |
![[ ]](/icons/layout.gif) | Essential Grammar in Use.pdf | 2023-11-29 12:33 | 82M | |
![[ ]](/icons/layout.gif) | Essential Grammar in Use - R. Murphy.pdf | 2023-11-13 15:48 | 13M | |
![[ ]](/icons/layout.gif) | Essential 3.pdf | 2023-11-13 15:49 | 9.5M | |
![[ ]](/icons/layout.gif) | Essential-Grammar-in-Use.pdf | 2023-11-13 12:11 | 15M | |
![[ ]](/icons/layout.gif) | Essays_from_examiners_task_2.pdf | 2023-11-15 09:55 | 904K | |
![[ ]](/icons/layout.gif) | Essays 9 by Ryan Higgins IELTS.pdf | 2023-11-28 17:23 | 378K | |
![[ ]](/icons/layout.gif) | Essay activator.pdf | 2023-11-30 15:46 | 763K | |
![[DIR]](/icons/folder.gif) | Enterprise4 Intermediate/ | 2024-01-03 13:02 | - | |
![[DIR]](/icons/folder.gif) | Enterprise3 Pre-Intermediate/ | 2024-01-03 13:01 | - | |
![[DIR]](/icons/folder.gif) | Enterprise2-Elementary/ | 2024-01-03 13:01 | - | |
![[DIR]](/icons/folder.gif) | Enterprise1 Beginner/ | 2024-01-03 13:00 | - | |
![[DIR]](/icons/folder.gif) | Enterprise1-Beginner/ | 2024-01-03 13:00 | - | |
![[ ]](/icons/layout.gif) | English vocabulary in use elementary.pdf | 2023-11-13 12:11 | 4.3M | |
![[ ]](/icons/layout.gif) | English unlimited C1 advanced.pdf | 2023-11-29 14:08 | 8.3M | |
![[ ]](/icons/layout.gif) | English unlimited B2 upper-intermediate.pdf | 2023-11-29 14:18 | 85M | |
![[DIR]](/icons/folder.gif) | English unlimited B1 pre-intermediate/ | 2024-01-03 12:56 | - | |
![[ ]](/icons/layout.gif) | English unlimited B1 pre-intermediate.pdf | 2023-11-29 12:31 | 36M | |
![[ ]](/icons/layout.gif) | English unlimited B1+ intermediate.pdf | 2023-11-29 12:33 | 73M | |
![[DIR]](/icons/folder.gif) | English unlimited A2 elementary/ | 2024-01-03 12:55 | - | |
![[ ]](/icons/layout.gif) | English unlimited A2 elementary.pdf | 2023-11-29 12:31 | 35M | |
![[ ]](/icons/layout.gif) | English unlimited A1 starter Teacher s.pdf | 2023-11-29 12:30 | 20M | |
![[DIR]](/icons/folder.gif) | English unlimited A1 starter CD/ | 2024-01-03 12:54 | - | |
![[ ]](/icons/layout.gif) | English unlimited A1 starter.pdf | 2023-11-29 12:29 | 16M | |
![[DIR]](/icons/folder.gif) | English unlimited A1 Teacher s pack/ | 2024-01-03 12:55 | - | |
![[ ]](/icons/layout.gif) | English phrasal verbs in use.pdf | 2023-11-30 15:48 | 7.6M | |
![[ ]](/icons/layout.gif) | English in topics (Sh.Abdullayev, Sh.Oripov va b.).pdf | 2023-11-22 10:04 | 13M | |
![[ ]](/icons/layout.gif) | English in 30 days (for Uzbek).pdf | 2023-11-21 11:04 | 6.0M | |
![[ ]](/icons/layout.gif) | English idioms in use Intermediate.pdf | 2023-11-02 11:17 | 52M | |
![[ ]](/icons/layout.gif) | English for economics in higher education studies. M.Roberts.pdf | 2023-11-22 11:34 | 48M | |
![[ ]](/icons/layout.gif) | English for Research Usage Style and Grammar__2012.pdf | 2023-11-28 17:23 | 1.5M | |
![[ ]](/icons/layout.gif) | English for Presentations at International Conferences.pdf | 2023-11-28 17:23 | 926K | |
![[ ]](/icons/layout.gif) | English_vocabulary_in_use_upper_inter_2.pdf | 2023-11-29 14:08 | 3.9M | |
![[ ]](/icons/layout.gif) | English_for_Everyone_English_Vocabulary_Builder.pdf | 2023-11-29 14:19 | 87M | |
![[ ]](/icons/layout.gif) | English_for_Everyone_English_Grammar_Guide_A_comprehensive_visual.pdf | 2023-11-09 15:35 | 25M | |
![[ ]](/icons/layout.gif) | English_Vocabulary_in_Use__Advanced.pdf | 2023-11-13 15:50 | 26M | |
![[ ]](/icons/layout.gif) | English_Vocabulary_Mega_Quiz_Book_5001_Solved_Examples_on_Words.pdf | 2023-11-29 11:58 | 1.0M | |
![[ ]](/icons/layout.gif) | English_II_O_Mo'minov,_X_Abdurahmonova,_S_Tohirjonova,_Sh_Bo'tayev.pdf | 2023-11-22 10:04 | 2.0M | |
![[ ]](/icons/layout.gif) | English_Grammar_in_Use_5th_edition.pdf | 2023-11-29 16:00 | 13M | |
![[DIR]](/icons/folder.gif) | English_File_Beginner_3e_Class_Audio/ | 2024-01-03 13:00 | - | |
![[ ]](/icons/layout.gif) | English_File_3e_-_Upper-Int_WB.pdf | 2023-11-06 09:55 | 12M | |
![[ ]](/icons/layout.gif) | English_File_3e_-_Upper-Int_TB.pdf | 2023-11-06 09:55 | 121M | |
![[ ]](/icons/layout.gif) | English_File_3e_-_Upper-Int_SB.pdf | 2023-11-06 09:53 | 87M | |
![[ ]](/icons/layout.gif) | English_File_3e_-_Intermediate_WB.pdf | 2023-11-06 09:52 | 18M | |
![[ ]](/icons/layout.gif) | English_File_3e_-_Intermediate_TB.pdf | 2023-11-06 09:52 | 50M | |
![[ ]](/icons/layout.gif) | English_File_3e_-_Intermediate_SB.pdf | 2023-11-06 09:51 | 41M | |
![[ ]](/icons/layout.gif) | English_File_3e_-_Intermediate_Plus_WB.pdf | 2023-11-06 09:53 | 11M | |
![[ ]](/icons/layout.gif) | English_File_3e_-_Intermediate_Plus_TB.pdf | 2023-11-06 09:53 | 55M | |
![[ ]](/icons/layout.gif) | English_File_3e_-_Elementary_WB.pdf | 2023-11-06 09:49 | 35M | |
![[ ]](/icons/layout.gif) | English_File_3e_-_Elementary_SB.pdf | 2023-11-06 09:48 | 82M | |
![[DIR]](/icons/folder.gif) | English_File_3e_-_Elementary_Audio_WB&SB/ | 2024-01-03 12:58 | - | |
![[DIR]](/icons/folder.gif) | English_File_3e_-_Elementary_Audio_SB&WB/ | 2024-01-03 12:58 | - | |
![[ ]](/icons/layout.gif) | English_File_3e_-_Beginner_WB.pdf | 2023-11-06 09:48 | 25M | |
![[DIR]](/icons/folder.gif) | English_File_3d_Advanced_WB_Cd&WB/ | 2024-01-03 12:57 | - | |
![[ ]](/icons/layout.gif) | English_File_3d_Advanced_SB.pdf | 2023-11-06 09:55 | 74M | |
![[DIR]](/icons/folder.gif) | English_File_3d_Advanced_Class_Cds&WB/ | 2024-01-03 12:57 | - | |
![[ ]](/icons/layout.gif) | English Vocabulary in Use Upper-Intermediate.pdf | 2023-11-02 11:17 | 17M | |
![[ ]](/icons/layout.gif) | English Vocabulary in Use 4th Ed..pdf | 2023-11-13 12:12 | 20M | |
![[ ]](/icons/layout.gif) | English Vocabulary in Use. Advanced.pdf | 2023-11-13 15:49 | 15M | |
![[ ]](/icons/layout.gif) | English Vocabulary in Use - Uppper Intermediate & Advanced.pdf | 2023-11-13 15:50 | 3.9M | |
![[ ]](/icons/layout.gif) | English Vocabulary In Use Pre-int-Int.pdf | 2023-11-13 15:49 | 5.0M | |
![[ ]](/icons/layout.gif) | English Vocabulary In Use.pdf | 2023-11-13 15:50 | 10M | |
![[DIR]](/icons/folder.gif) | English Unlimited B1_Bilingual Wordlists/ | 2024-01-03 12:56 | - | |
![[DIR]](/icons/folder.gif) | English Unlimited A2_Bilingual Wordlists/ | 2024-01-03 12:55 | - | |
![[DIR]](/icons/folder.gif) | English Unlimited A1_Bilingual Wordlists/ | 2024-01-03 12:55 | - | |
![[ ]](/icons/layout.gif) | English Unlimited. Pre-Intermediate B1.pdf | 2023-11-10 16:49 | 71M | |
![[ ]](/icons/layout.gif) | English Through Reading.pdf | 2023-11-13 12:08 | 3.4M | |
![[ ]](/icons/layout.gif) | English Pronunciation in Use - Elementary_J Marks.pdf | 2023-11-13 12:12 | 42M | |
![[ ]](/icons/layout.gif) | English Literature from the_Rest J.E.Luebering.pdf | 2023-11-22 11:34 | 4.1M | |
![[ ]](/icons/layout.gif) | English Literature from the 19th J.E.Luebering.pdf | 2023-11-22 11:34 | 5.8M | |
![[ ]](/icons/layout.gif) | English Legal System 2016_2017 ( PDFDrive ).pdf | 2023-11-10 13:24 | 11M | |
![[ ]](/icons/layout.gif) | English Legal System 2016_2017 ( PDFDrive ) (1).pdf | 2023-11-10 16:48 | 11M | |
![[ ]](/icons/layout.gif) | English Language Studies. Nasibe Sevgi Ondeş.pdf | 2023-11-15 10:21 | 3.3M | |
![[ ]](/icons/layout.gif) | English Language Communication Skills.pdf | 2023-11-22 11:27 | 45M | |
![[ ]](/icons/layout.gif) | English Idioms in Use - Intermediate.pdf | 2023-11-29 14:18 | 80M | |
![[ ]](/icons/layout.gif) | English III (G.Bakiyev, G.Mahkamova, A.Quldoshev).pdf | 2023-11-22 10:04 | 1.3M | |
![[ ]](/icons/layout.gif) | English I (T.Sattorov, N.Qambarov, K.Nabiyeva).pdf | 2023-11-22 10:04 | 1.1M | |
![[ ]](/icons/layout.gif) | English Grammar in Use-[Raymond_Murphy].pdf | 2023-11-21 15:51 | 73M | |
![[ ]](/icons/layout.gif) | EnglishGrammar.pdf | 2023-11-13 12:12 | 63M | |
![[ ]](/icons/layout.gif) | English Fluency For Advanced English Sp.pdf | 2023-11-29 14:08 | 4.1M | |
![[ ]](/icons/layout.gif) | English File Beginner 3rd Student's Book.pdf | 2023-11-06 09:47 | 64M | |
![[DIR]](/icons/folder.gif) | English File 3ed-Pre-Intermediate WB CD/ | 2024-01-03 12:54 | - | |
![[ ]](/icons/layout.gif) | English Collocations in use Intermediate.pdf | 2023-11-02 11:17 | 18M | |
![[ ]](/icons/layout.gif) | English Collocations in use-Advanced.pdf | 2023-11-13 12:05 | 25M | |
![[ ]](/icons/layout.gif) | English Collocations in Use Advanced.pdf | 2023-11-29 16:01 | 25M | |
![[ ]](/icons/layout.gif) | English Collocations in Use - Intermediate.pdf | 2023-11-29 10:48 | 18M | |
![[ ]](/icons/layout.gif) | English-pronunciation-in-use-intermediate.pdf | 2023-11-13 12:13 | 19M | |
![[ ]](/icons/layout.gif) | English-Grammar-in-Use.-Murphy-R.-2019.pdf | 2023-10-30 15:11 | 6.1M | |
![[ ]](/icons/layout.gif) | English-Grammar-in-Use.-Murphy-R.-2019-5th-394p- (1).pdf | 2023-10-27 17:13 | 6.1M | |
![[ ]](/icons/layout.gif) | Engaging and Motivating Lessons with EF4th.pdf | 2023-11-28 17:24 | 3.0M | |
![[ ]](/icons/layout.gif) | Engaging and Motivating Lessons with EF4th (1).pdf | 2023-11-28 17:24 | 3.0M | |
![[DIR]](/icons/folder.gif) | Elementary/ | 2024-01-03 12:51 | - | |
![[ ]](/icons/layout.gif) | Effective academic writing 2 (2) Oxford University, ansver key.pdf | 2023-10-27 09:22 | 560K | |
![[ ]](/icons/layout.gif) | Effective academic writing (2) Oxford University, ansver key.pdf | 2023-10-27 09:22 | 34M | |
![[ ]](/icons/layout.gif) | Effective academic writing (1) Oxford University, ansver key.pdf | 2023-10-27 09:22 | 441K | |
![[ ]](/icons/layout.gif) | Effective academic writing (1), Oxford University, ansver key.pdf | 2023-10-27 09:22 | 441K | |
![[ ]](/icons/layout.gif) | Effective_Academic_Writing_Second.pdf | 2023-11-02 11:19 | 12M | |
![[ ]](/icons/layout.gif) | Effective_Academic_Writing_Second (2).pdf | 2023-11-02 11:19 | 13M | |
![[ ]](/icons/layout.gif) | Effective_Academic_Writing_Second (1).pdf | 2023-11-02 11:19 | 11M | |
![[ ]](/icons/layout.gif) | Effective Academic Writing Complete 2.pdf | 2023-11-22 11:34 | 38M | |
![[ ]](/icons/layout.gif) | Effective Academic Writing Complete 1.pdf | 2023-11-22 11:34 | 34M | |
![[ ]](/icons/layout.gif) | Easy Japanese_ Learn to Speak Japanese Quickly!.pdf | 2023-11-10 16:49 | 8.4M | |
![[ ]](/icons/layout.gif) | Easier English Basic Synonyms.pdf | 2023-11-29 14:09 | 2.4M | |
![[ ]](/icons/layout.gif) | ESL Podcast - A Day in the Life of Jeff.pdf | 2023-11-29 14:09 | 1.6M | |
![[ ]](/icons/layout.gif) | ESL English Through Reading intermed.pdf | 2023-11-29 15:53 | 1.3M | |
![[ ]](/icons/layout.gif) | EN_UZ_RU lug'at so'zlar.pdf | 2023-11-21 11:04 | 2.0M | |
![[ ]](/icons/layout.gif) | ENGLISH PRONUNCIATION IN USE ADVANCED.pdf | 2023-11-13 12:15 | 8.9M | |
![[ ]](/icons/layout.gif) | ENGLISH LITERATURE.pdf | 2023-11-03 16:58 | 942K | |
![[ ]](/icons/layout.gif) | Download.pdf | 2023-11-20 16:31 | 23M | |
![[ ]](/icons/layout.gif) | Diyorbek's IELTS.pdf | 2023-11-15 10:12 | 29M | |
![[ ]](/icons/layout.gif) | Diana Hopkins - Grammar for IELTS.pdf | 2023-11-20 11:50 | 24M | |
![[ ]](/icons/layout.gif) | Devoni lug'otut turk. 1-jild (Mahmud Koshg'ariy).pdf | 2023-11-13 15:18 | 14M | |
![[ ]](/icons/layout.gif) | Deutsche grammatik in ubungen (S.Saidow).pdf | 2023-11-22 10:04 | 7.7M | |
![[ ]](/icons/layout.gif) | Deutsch_II_A_Abdullayeva,_D_Mirsodiqova,_S_Abdullayeva,_D_Nosirov.pdf | 2023-11-22 10:04 | 3.2M | |
![[ ]](/icons/layout.gif) | Deutsch III (G.Pan, Sh.Karimov, D.Ismatillayeva).pdf | 2023-11-22 10:04 | 1.4M | |
![[ ]](/icons/layout.gif) | Deutsch I (M.Dadaxodjayeva, S.Novikova, S.Ziyayeva).pdf | 2023-11-22 10:04 | 2.3M | |
![[ ]](/icons/layout.gif) | Deutsch (S.Naimow, M.Bosorow).pdf | 2023-11-22 10:04 | 3.4M | |
![[ ]](/icons/layout.gif) | Deutsch (A.Jumaniyazov, Q.Xalliyeva).pdf | 2023-11-22 10:04 | 5.5M | |
![[ ]](/icons/layout.gif) | Destination_A2.pdf | 2023-11-28 17:29 | 39M | |
![[ ]](/icons/layout.gif) | Destination C1 and C2.pdf | 2023-11-28 17:26 | 12M | |
![[ ]](/icons/layout.gif) | Destination C1 and C2(1).pdf | 2023-11-29 16:00 | 12M | |
![[ ]](/icons/layout.gif) | Destination C1 - C2.pdf | 2023-11-20 12:08 | 155M | |
![[ ]](/icons/layout.gif) | Destination C1 & C2.pdf | 2023-11-15 10:21 | 8.7M | |
![[ ]](/icons/layout.gif) | Destination B2 grammar and vocabulary with keys.pdf | 2023-11-15 10:20 | 26M | |
![[ ]](/icons/layout.gif) | Destination B2.pdf | 2023-11-28 17:26 | 14M | |
![[ ]](/icons/layout.gif) | Destination B1 grammar and vocabulary with keys.pdf | 2023-11-15 10:21 | 26M | |
![[ ]](/icons/layout.gif) | Destination B1.pdf | 2023-11-28 17:26 | 12M | |
![[ ]](/icons/layout.gif) | Destination B1 - o'zbekcha.pdf | 2023-11-13 15:18 | 405K | |
![[ ]](/icons/layout.gif) | Destination A1.pdf | 2023-11-28 17:28 | 25M | |
![[ ]](/icons/layout.gif) | Design_Thinking_for_the_Greater_Good_by_Liedtka,_JeanneAzer,_DaisySalzman.pdf | 2023-10-27 17:13 | 5.2M | |
![[ ]](/icons/layout.gif) | David Hill - English for Information Technology 2.pdf | 2023-11-20 11:50 | 26M | |
![[ ]](/icons/layout.gif) | Data Structures and Algorithms in Python (en).pdf | 2023-11-13 15:51 | 6.6M | |
![[ ]](/icons/layout.gif) | Daily_reading_comprehension-evan_moor.pdf | 2023-11-13 12:11 | 9.9M | |
![[ ]](/icons/layout.gif) | DO YOU WANT TO SPEAK BETTER.pdf | 2023-11-15 10:14 | 246K | |
![[ ]](/icons/layout.gif) | Cultural Diplomacy Dictionary.pdf | 2023-11-22 15:36 | 1.2M | |
![[ ]](/icons/layout.gif) | Conversational chinesse 301 workbook.pdf | 2023-10-26 16:16 | 18M | |
![[ ]](/icons/layout.gif) | Conversational Chinese 301-B.pdf | 2023-10-30 17:50 | 29M | |
![[ ]](/icons/layout.gif) | Connectors 1 .pdf | 2023-11-29 15:53 | 87K | |
![[ ]](/icons/layout.gif) | Complete IELTS bands 5-6.5 Student's book.pdf | 2023-11-22 11:35 | 83M | |
![[ ]](/icons/layout.gif) | Complete IELTS bands 4-5 with Answers.pdf | 2023-10-27 09:22 | 93M | |
![[ ]](/icons/layout.gif) | Complete IELTS bands 4-5.pdf | 2023-10-27 09:22 | 14M | |
![[ ]](/icons/layout.gif) | Complete IELTS Level 3.pdf | 2023-11-13 12:10 | 18M | |
![[DIR]](/icons/folder.gif) | Complete IELTS Bands 6.5-7.5 WorkBook Audios and Book/ | 2024-01-03 12:50 | - | |
![[DIR]](/icons/folder.gif) | Complete IELTS Bands 6.5-7.5 Student's Book Audios and Book/ | 2024-01-03 12:50 | - | |
![[ ]](/icons/layout.gif) | Complete IELTS Bands 4-5 Teachers Book.pdf | 2023-11-22 11:26 | 14M | |
![[ ]](/icons/layout.gif) | Complete IELTS Bands 4-5 Teachers Book (1).pdf | 2023-11-22 11:35 | 14M | |
![[ ]](/icons/layout.gif) | Complete IELTS Bands 4-5 Students Book.pdf | 2023-11-22 11:26 | 93M | |
![[ ]](/icons/layout.gif) | Complete IELTS Bands 4-5 Student's Book.pdf | 2023-11-22 15:36 | 93M | |
![[ ]](/icons/layout.gif) | Complete IELTS Band 5-6.5 Workbook M.Harrison.pdf | 2023-11-22 15:36 | 6.9M | |
![[ ]](/icons/layout.gif) | Complete IELTS B2 Cambridge.pdf | 2023-11-13 12:08 | 52M | |
![[ ]](/icons/layout.gif) | Complete CAE (2nd) WB.pdf | 2023-11-29 14:13 | 27M | |
![[ ]](/icons/layout.gif) | Complete Advanced SB.pdf | 2023-11-29 14:18 | 78M | |
![[ ]](/icons/layout.gif) | Complate IELTS (bands 5-6.5) workbook with answers.pdf | 2023-10-27 09:22 | 6.9M | |
![[ ]](/icons/layout.gif) | Complate IELTS (bands 5-6.5) with answers.pdf | 2023-10-27 09:22 | 83M | |
![[ ]](/icons/layout.gif) | Compact writing Graph Review.pdf | 2023-11-15 10:14 | 11M | |
![[ ]](/icons/layout.gif) | Compact Advanced C1. Student's Book with Answers.pdf | 2023-11-09 16:55 | 37M | |
![[ ]](/icons/layout.gif) | Common_Mistakes_at_IELTS_Advanced.pdf | 2023-11-06 09:45 | 31M | |
![[ ]](/icons/layout.gif) | Common Mistakes in IELTS Writing.pdf | 2023-11-15 09:55 | 4.7M | |
![[ ]](/icons/layout.gif) | Common Mistakes at IELTS Intermediate @linguabarno.pdf | 2023-11-29 15:55 | 1.7M | |
![[ ]](/icons/layout.gif) | Colourful Vocabularies .pdf | 2023-11-29 14:09 | 52K | |
![[ ]](/icons/layout.gif) | Collocations ni tarjimasi.pdf | 2023-11-29 15:51 | 193K | |
![[ ]](/icons/layout.gif) | Collocations in Use Advanced 2nd.pdf | 2023-11-29 10:49 | 25M | |
![[ ]](/icons/layout.gif) | Collocations in Use - Advanced.pdf | 2023-11-30 15:51 | 73M | |
![[ ]](/icons/layout.gif) | Collocations and Phrases about -Travel and Transport- .pdf | 2023-11-29 14:09 | 66K | |
![[ ]](/icons/layout.gif) | Collocations In Use - Multi.pdf | 2023-11-30 15:51 | 61M | |
![[ ]](/icons/layout.gif) | Collins_Writing_for_IELTS_Book.pdf | 2023-11-06 10:16 | 96M | |
![[DIR]](/icons/folder.gif) | Collins_Vocabulary_for_IELTS_Audio_and_Book/ | 2024-01-03 12:48 | - | |
![[DIR]](/icons/folder.gif) | Collins_Speaking_for_IELTS_Audio and Book/ | 2024-01-03 12:48 | - | |
![[ ]](/icons/layout.gif) | Collins_Reading_for_IELTS_Book.pdf | 2023-11-06 10:17 | 78M | |
![[DIR]](/icons/folder.gif) | Collins_Listening_for_IELTS_Audio/ | 2024-01-03 12:47 | - | |
![[ ]](/icons/layout.gif) | Collins_Grammar_for_IELTS Book.pdf | 2023-11-06 10:17 | 2.8M | |
![[DIR]](/icons/folder.gif) | Collins Listening for IELTS audios and Book/ | 2024-01-03 12:47 | - | |
![[ ]](/icons/layout.gif) | Collection IELTS Essays.pdf | 2023-11-28 17:25 | 3.3M | |
![[ ]](/icons/layout.gif) | Cognitive_Linguistic_Approaches_to_Teaching_Vocabulary_and_Phraseology.pdf | 2023-11-22 15:36 | 3.8M | |
![[ ]](/icons/layout.gif) | Cognitive Foundations of Grammar.pdf | 2023-11-06 09:54 | 11M | |
![[ ]](/icons/layout.gif) | Chinese lanuage.pdf | 2023-11-02 11:18 | 138M | |
![[ ]](/icons/layout.gif) | Chinese_Made_Super_Easy_A_Superb.pdf | 2023-11-06 16:21 | 6.0M | |
![[ ]](/icons/layout.gif) | Chinese_English_Bilingual_Visual_Dictionary.pdf | 2023-11-07 10:52 | 45M | |
![[ ]](/icons/layout.gif) | Chinese Vocabulary.pdf | 2023-11-08 13:25 | 2.6M | |
![[ ]](/icons/layout.gif) | Chineasy The New Way to Read Chinese ( PDFDrive ).pdf | 2023-11-09 15:34 | 13M | |
![[ ]](/icons/layout.gif) | Chet tili-Ingliz tili-fanidan o'quv-uslubiy majmua.pdf | 2023-10-31 11:43 | 34M | |
![[ ]](/icons/layout.gif) | Chet mamlakatlar soliq tizimi 2011.pdf | 2023-11-03 10:09 | 14M | |
![[ ]](/icons/layout.gif) | Check Your Vocabulary For PET.pdf | 2023-11-29 10:52 | 151M | |
![[ ]](/icons/layout.gif) | Check Your Vocabulary For FCE.pdf | 2023-11-29 10:45 | 1.5M | |
![[ ]](/icons/layout.gif) | Check Your English Vocabulary For Law (Rawdon Wyatt).pdf | 2023-11-10 13:28 | 379K | |
![[ ]](/icons/layout.gif) | Change Your Thoughts, Change Your Life.pdf | 2023-11-15 09:55 | 6.5M | |
![[DIR]](/icons/folder.gif) | Certificate in Advanced English & Audio CDS Level 2/ | 2024-01-03 12:45 | - | |
![[ ]](/icons/layout.gif) | Cambridge grammar of English.pdf | 2023-11-15 10:21 | 5.4M | |
![[ ]](/icons/layout.gif) | Cambridge cerificate in Advanced English 4 ANSWERS.pdf | 2023-11-30 15:47 | 806K | |
![[ ]](/icons/layout.gif) | Cambridge_University_Press_English_Vocabulary_in_Use_Elementary.pdf | 2023-11-29 15:59 | 4.3M | |
![[ ]](/icons/layout.gif) | Cambridge_Academic_English_An_Integrated_Skills_Course_for_EAP_Student's.pdf | 2023-11-03 16:44 | 128M | |
![[DIR]](/icons/folder.gif) | Cambridge Practice Tests for IELTS 14 CD and book/ | 2024-01-03 12:44 | - | |
![[DIR]](/icons/folder.gif) | Cambridge Practice Tests for IELTS 13 CD and book/ | 2024-01-03 12:44 | - | |
![[DIR]](/icons/folder.gif) | Cambridge Practice Tests for IELTS 12 CD and book/ | 2024-01-03 12:44 | - | |
![[DIR]](/icons/folder.gif) | Cambridge Practice Tests for IELTS 11 CD and book/ | 2024-01-03 12:44 | - | |
![[DIR]](/icons/folder.gif) | Cambridge Practice Tests for IELTS 10 CD and book/ | 2024-01-03 12:43 | - | |
![[DIR]](/icons/folder.gif) | Cambridge Practice Tests for IELTS 9 CD and book/ | 2024-01-03 12:44 | - | |
![[ ]](/icons/layout.gif) | Cambridge Practice Tests 3.pdf | 2023-11-29 15:54 | 3.2M | |
![[ ]](/icons/layout.gif) | Cambridge Practice IELTS Tests 2.pdf | 2023-11-29 15:53 | 572K | |
![[ ]](/icons/layout.gif) | Cambridge IELTS Practice Tests 15.pdf | 2023-11-29 12:30 | 28M | |
![[ ]](/icons/layout.gif) | Cambridge IELTS Practice Tests 14.pdf | 2023-11-29 12:31 | 40M | |
![[ ]](/icons/layout.gif) | Cambridge IELTS 13 AC.pdf | 2023-11-29 12:28 | 13M | |
![[ ]](/icons/layout.gif) | Cambridge IELTS 12.pdf | 2023-11-29 12:33 | 89M | |
![[ ]](/icons/layout.gif) | Cambridge IELTS 11.pdf | 2023-11-29 12:32 | 54M | |
![[ ]](/icons/layout.gif) | Cambridge IELTS 10.pdf | 2023-11-29 16:01 | 29M | |
![[ ]](/icons/layout.gif) | Cambridge IELTS 9.pdf | 2023-11-29 16:00 | 24M | |
![[ ]](/icons/layout.gif) | Cambridge IELTS 8.pdf | 2023-11-29 15:55 | 4.2M | |
![[ ]](/icons/layout.gif) | Cambridge IELTS 7.pdf | 2023-11-29 16:00 | 24M | |
![[ ]](/icons/layout.gif) | Cambridge IELTS 6 test4.pdf | 2023-11-29 15:55 | 11M | |
![[ ]](/icons/layout.gif) | Cambridge IELTS 6 test 3.pdf | 2023-11-29 15:55 | 12M | |
![[ ]](/icons/layout.gif) | Cambridge IELTS 6 test 2.pdf | 2023-11-29 16:00 | 8.5M | |
![[ ]](/icons/layout.gif) | Cambridge IELTS 6 test 1.pdf | 2023-11-29 15:54 | 2.6M | |
![[ ]](/icons/layout.gif) | Cambridge IELTS 5 with answers.pdf | 2023-11-29 15:55 | 13M | |
![[ ]](/icons/layout.gif) | Cambridge IELTS 5 with Answers_.pdf | 2023-11-13 15:18 | 14M | |
![[ ]](/icons/layout.gif) | Cambridge IELTS 1.pdf | 2023-11-29 15:54 | 2.8M | |
![[ ]](/icons/layout.gif) | Cambridge Grammar for IELTS.pdf | 2023-11-29 16:06 | 81M | |
![[ ]](/icons/layout.gif) | Cambridge Certificate in advanced english.pdf | 2023-11-30 15:47 | 2.9M | |
![[ ]](/icons/layout.gif) | Cambridge Certificate in Advanced English 3.pdf | 2017-07-24 16:03 | 64M | |
![[DIR]](/icons/folder.gif) | Cambridge Action Plan for IELTS/ | 2024-01-03 12:42 | - | |
![[ ]](/icons/layout.gif) | Cambridge 17 Test 1.pdf | 2023-11-15 09:54 | 157K | |
![[ ]](/icons/layout.gif) | Cambridge 17.pdf | 2023-11-15 09:55 | 35M | |
![[ ]](/icons/layout.gif) | Cambridge 16 Practice Test.pdf | 2023-11-29 16:00 | 36M | |
![[DIR]](/icons/folder.gif) | Cambridge-Practice-Tests-for-IELTS-8-CD/ | 2024-01-03 12:45 | - | |
![[DIR]](/icons/folder.gif) | Cambridge-Practice-Tests-for-IELTS-7-CD/ | 2024-01-03 12:45 | - | |
![[DIR]](/icons/folder.gif) | Cambridge-Practice-Tests-for-IELTS-6-CD/ | 2024-01-03 12:45 | - | |
![[DIR]](/icons/folder.gif) | Cambridge-Practice-Tests-for-IELTS-5-CD/ | 2024-01-03 12:45 | - | |
![[DIR]](/icons/folder.gif) | Cambridge-Practice-Tests-for-IELTS-4-CD/ | 2024-01-03 12:45 | - | |
![[DIR]](/icons/folder.gif) | Cambridge-Practice-Tests-for-IELTS-3/ | 2024-01-03 12:45 | - | |
![[DIR]](/icons/folder.gif) | Cambridge-Practice-Tests-for-IELTS-2-CD/ | 2024-01-03 12:44 | - | |
![[ ]](/icons/layout.gif) | Cambridge-Practice-Tests-for-IELTS-2-Book.pdf | 2023-11-29 15:54 | 572K | |
![[DIR]](/icons/folder.gif) | Cambridge-Practice-Tests-for-IELTS-1-CD/ | 2024-01-03 12:44 | - | |
![[ ]](/icons/layout.gif) | Cambridge - Grammar for IELTS.pdf | 2023-11-29 16:06 | 78M | |
![[ ]](/icons/layout.gif) | Cambridge-English-Vocabulary-in-Use-Elementary-1999(1).pdf | 2023-11-13 15:50 | 4.3M | |
![[ ]](/icons/layout.gif) | CEFR TASK 1 2.pdf | 2023-11-28 17:23 | 257K | |
![[ ]](/icons/layout.gif) | Business language Saidakbarova Saodat Parxadjanovna.pdf | 2023-11-22 15:36 | 5.3M | |
![[ ]](/icons/layout.gif) | Business language Saidakbarova Saodat Parxadjanovna (2).pdf | 2023-10-27 09:22 | 5.3M | |
![[ ]](/icons/layout.gif) | Business language.pdf | 2023-10-27 09:22 | 5.3M | |
![[ ]](/icons/layout.gif) | Business_Idioms_in_America.pdf | 2023-11-28 17:23 | 2.1M | |
![[ ]](/icons/layout.gif) | Business English Course.pdf | 2023-11-22 10:04 | 4.6M | |
![[DIR]](/icons/folder.gif) | Business English Books/ | 2024-01-03 12:42 | - | |
![[ ]](/icons/layout.gif) | Brush up your English.pdf | 2023-11-22 10:04 | 28M | |
![[ ]](/icons/layout.gif) | Boya_Chinese_Elementary_II.pdf | 2023-11-08 14:15 | 89M | |
![[ ]](/icons/layout.gif) | Boya_Chinese_Elementary_I.pdf | 2023-11-08 14:16 | 100M | |
![[ ]](/icons/layout.gif) | Bonu Iqbol Mirro 2020.yil.pdf | 2023-10-31 12:58 | 139M | |
![[ ]](/icons/layout.gif) | Better Writing Right Now!.pdf | 2023-11-28 17:24 | 851K | |
![[ ]](/icons/layout.gif) | Beginner_elementary_placement_tests_ Answers.pdf | 2023-11-13 15:03 | 17K | |
![[ ]](/icons/layout.gif) | Basic Student Book.pdf | 2023-11-30 15:50 | 50M | |
![[ ]](/icons/layout.gif) | Basic Patterns of Chinese Gramm - Qin Xue Herzberg.pdf | 2023-11-07 10:51 | 883K | |
![[ ]](/icons/layout.gif) | Basic IELTS listening.pdf | 2023-11-30 15:46 | 19M | |
![[ ]](/icons/layout.gif) | Basic IELTS Reading.pdf | 2023-11-30 15:50 | 43M | |
![[ ]](/icons/layout.gif) | Basic English Grammar Book 2.pdf | 2023-11-13 15:19 | 1.9M | |
![[ ]](/icons/layout.gif) | Barron s IELTS Practice exam.pdf | 2023-11-29 12:30 | 30M | |
![[DIR]](/icons/folder.gif) | Barrons IELTS/ | 2024-01-03 12:40 | - | |
![[ ]](/icons/layout.gif) | Barhudarov Language and translation.pdf | 2023-11-22 15:35 | 1.3M | |
![[ ]](/icons/layout.gif) | Barcha-zamonlar-yasalish-formulasi.pdf | 2023-11-29 15:54 | 18K | |
![[ ]](/icons/layout.gif) | Bands 5-6.5 Student's Book.pdf | 2023-11-30 15:50 | 49M | |
![[ ]](/icons/layout.gif) | Band 9 IELTS Academic Task 2.pdf | 2023-11-29 16:00 | 6.5M | |
![[ ]](/icons/layout.gif) | Band 9 IELTS Academic Task 1.pdf | 2023-11-29 15:53 | 9.2M | |
![[ ]](/icons/layout.gif) | Band 9 IELTS Academic Task 1 (1).pdf | 2023-11-29 16:00 | 9.2M | |
![[ ]](/icons/layout.gif) | Bakoeva M. Muratova E., Ochilova M. English Literature.pdf | 2023-11-22 15:36 | 4.1M | |
![[ ]](/icons/layout.gif) | BOYA_Chinese_Stupen_2_Uchebnik.pdf | 2023-10-26 16:16 | 103M | |
![[ ]](/icons/layout.gif) | BOYA_Chinese_Stupen_1_Uchebnik.pdf | 2023-10-26 16:16 | 47M | |
![[ ]](/icons/layout.gif) | Azar Fundamentals of english grammar-3.pdf | 2023-11-15 10:21 | 13M | |
![[ ]](/icons/layout.gif) | Audioscrips_to_understand_the_Listening_taskreorder_pagenumbered.pdf | 2023-11-29 15:51 | 2.4M | |
![[DIR]](/icons/folder.gif) | Audio Cambridge 15 - sharenha.com/ | 2024-01-03 12:40 | - | |
![[ ]](/icons/layout.gif) | At-Takallum. A Comprehensive modern arabic course .pdf | 2023-11-22 11:29 | 10M | |
![[ ]](/icons/layout.gif) | Assosiativ tilshunoslik nazariyasi D.E Lutfullaeva.pdf | 2023-10-30 15:13 | 36M | |
![[ ]](/icons/layout.gif) | Assosiativ tilshunoslik nazariyasi.pdf | 2023-10-31 12:54 | 27M | |
![[ ]](/icons/layout.gif) | Askiya matni lingvostilistikasi.H.Do'smatov..pdf | 2023-10-31 11:42 | 5.4M | |
![[ ]](/icons/layout.gif) | Arab tili o'quv uslubiy majmua.pdf | 2023-10-31 11:54 | 9.1M | |
![[ ]](/icons/layout.gif) | Arab tili grmatikasi 1 jild. N. Ibrohimov..pdf | 2023-11-01 14:31 | 9.1M | |
![[ ]](/icons/layout.gif) | Arab tilidan nazorat ishlar va mashqlar. Y.A.Ismailova.pdf | 2023-11-22 15:36 | 823K | |
![[ ]](/icons/layout.gif) | Arab tilidan boshlang`ich kurs. G.A.Astanova.pdf | 2023-11-22 15:36 | 1.6M | |
![[ ]](/icons/layout.gif) | Arab tili M. Bahodirov.pdf | 2023-10-31 10:48 | 3.1M | |
![[ ]](/icons/layout.gif) | Arab tili.pdf | 2023-11-22 10:03 | 2.5M | |
![[ ]](/icons/layout.gif) | Arab tili. Orifxo'jaev N.pdf | 2023-11-01 14:30 | 5.2M | |
![[ ]](/icons/layout.gif) | Arab tili. E.Talabov.pdf | 2023-10-30 15:11 | 17M | |
![[ ]](/icons/layout.gif) | Arab hatotligi. A.Shoyunusov.pdf | 2023-11-22 15:36 | 33M | |
![[ ]](/icons/layout.gif) | Arabcha-o'zbekcha boshlang'ich lug'at (Botirbek Hasanov).pdf | 2023-10-27 09:22 | 12M | |
![[ ]](/icons/layout.gif) | Arabcha-Ozbekcha.pdf | 2023-11-21 11:44 | 12M | |
![[ ]](/icons/layout.gif) | Arab adabiy tilining fonetikasi T.Qodirov.pdf | 2023-10-26 16:16 | 1.5M | |
![[ ]](/icons/layout.gif) | Arab adabiyoti.M.Ziyovuddinova..pdf | 2023-10-31 11:42 | 6.9M | |
![[ ]](/icons/layout.gif) | Arab_tili_bo‘yicha_matn_va_mashqlar_to‘plami_H_A_Soipova.pdf | 2023-11-22 15:36 | 761K | |
![[ ]](/icons/layout.gif) | Arab-tili-darslari.pdf | 2023-11-28 17:27 | 8.4M | |
![[ ]](/icons/layout.gif) | Arab-tili-darslari. M.Xasanov.pdf | 2023-11-22 15:36 | 8.4M | |
![[ ]](/icons/layout.gif) | Arab-tili-darslari-hasanov.pdf | 2023-11-13 15:18 | 7.5M | |
![[ ]](/icons/layout.gif) | Answers test 1.pdf | 2023-11-30 15:46 | 338K | |
![[ ]](/icons/layout.gif) | An_Introduction_to_Language_and_Linguistics.pdf | 2023-11-22 11:27 | 9.7M | |
![[ ]](/icons/layout.gif) | An Introduction to Language and Linguistics.pdf | 2023-11-22 15:36 | 9.7M | |
![[ ]](/icons/layout.gif) | Amaliy tilshunoslik va adabiyotshunoslik.pdf | 2023-10-30 16:16 | 38M | |
![[ ]](/icons/layout.gif) | All_the_grammar_and_language_points_for_each_of_the_six_levels_of.pdf | 2023-11-13 15:19 | 5.5M | |
![[ ]](/icons/layout.gif) | Alisher_Absalomov_Rus_tilini_o'rganishning_eng_samarali_usullari.pdf | 2023-11-22 10:01 | 893K | |
![[ ]](/icons/layout.gif) | Al-Arabia_Bayna_Yadayk_-_Chast_1_A.pdf | 2023-11-22 11:29 | 125M | |
![[ ]](/icons/layout.gif) | Al-Arabi-bin-Yadik-4-B.pdf | 2023-10-31 11:06 | 32M | |
![[ ]](/icons/layout.gif) | Al-Arabi-bin-Yadik-4-A.pdf | 2023-10-31 11:01 | 32M | |
![[ ]](/icons/layout.gif) | Al-Arabi-bin-Yadik-3-B.pdf | 2023-10-26 16:16 | 112M | |
![[ ]](/icons/layout.gif) | Al-Arabi-bin-Yadik-3-A_compressed.pdf | 2023-10-31 11:19 | 29M | |
![[ ]](/icons/layout.gif) | Al-Arabi-bin-Yadik-3-A.pdf | 2023-10-31 15:59 | 29M | |
![[ ]](/icons/layout.gif) | Al-Arabi-bin-Yadik-2-B.pdf | 2023-10-26 16:16 | 110M | |
![[ ]](/icons/layout.gif) | Al-Arabi-bin-Yadik-2-A.pdf | 2023-10-26 16:16 | 112M | |
![[ ]](/icons/layout.gif) | Al-Arabi-bin-Yadik-1-B.pdf | 2023-10-31 11:06 | 30M | |
![[ ]](/icons/layout.gif) | Al-Arabi-bin-Yadik-1-A.pdf | 2023-10-31 15:56 | 29M | |
![[ ]](/icons/layout.gif) | Advancing your phrasal verbs book 1.pdf | 2023-11-29 10:44 | 5.8M | |
![[ ]](/icons/layout.gif) | Advancing Vocabulary.pdf | 2023-11-29 15:51 | 7.9M | |
![[ ]](/icons/unknown.gif) | Advanced_Grammar_in_Use_Martin_Hewings_3rd_edition_2013.PDF | 2023-11-20 12:08 | 102M | |
![[ ]](/icons/layout.gif) | Advanced_English_Grammar_The_Superior_English_Grammar_Guide_Packed.pdf | 2023-11-28 17:27 | 6.8M | |
![[ ]](/icons/layout.gif) | A dictionary of confusable phrases.pdf | 2023-11-15 10:21 | 4.7M | |
![[ ]](/icons/layout.gif) | Adam Smith - Writing Task 1.pdf | 2023-11-15 10:14 | 4.1M | |
![[ ]](/icons/layout.gif) | Adam Smith - Speaking.pdf | 2023-11-30 15:46 | 447K | |
![[ ]](/icons/layout.gif) | Adabiyotshunoslik_atamalarining_qisqacha_isohli_lug'ati_Shodmon.pdf | 2023-10-30 16:16 | 42M | |
![[ ]](/icons/layout.gif) | Active Skills for Reading - 3.pdf | 2023-11-28 17:27 | 26M | |
![[ ]](/icons/layout.gif) | Achieve IELTS.pdf | 2023-11-29 12:30 | 9.5M | |
![[ ]](/icons/layout.gif) | Ace The IELTS Essential Tips for IELTS General Training Mo.pdf | 2023-11-28 17:23 | 465K | |
![[ ]](/icons/layout.gif) | Academic writing, a handbook for international, Bailey Stephen.pdf | 2023-10-27 09:22 | 1.0M | |
![[ ]](/icons/layout.gif) | Academic skills.pdf | 2023-10-27 09:22 | 57M | |
![[ ]](/icons/layout.gif) | Academic_Word_List_-_Sublist_10.pdf | 2023-11-15 10:12 | 201K | |
![[ ]](/icons/layout.gif) | Academic_Word_List_-_Sublist_9.pdf | 2023-11-15 10:12 | 196K | |
![[ ]](/icons/layout.gif) | Academic_Word_List_-_Sublist_8.pdf | 2023-11-15 10:12 | 475K | |
![[ ]](/icons/layout.gif) | Academic_Word_List_-_Sublist_7.pdf | 2023-11-15 10:12 | 198K | |
![[ ]](/icons/layout.gif) | Academic_Word_List_-_Sublist_6.pdf | 2023-11-15 10:12 | 194K | |
![[ ]](/icons/layout.gif) | Academic_Word_List_-_Sublist_5.pdf | 2023-11-15 09:57 | 488K | |
![[ ]](/icons/layout.gif) | Academic_Word_List_-_Sublist_4.pdf | 2023-11-15 09:57 | 542K | |
![[ ]](/icons/layout.gif) | Academic_Word_List_-_Sublist_3.pdf | 2023-11-15 09:57 | 190K | |
![[ ]](/icons/layout.gif) | Academic_Word_List_-_Sublist_2.pdf | 2023-11-15 09:57 | 191K | |
![[ ]](/icons/layout.gif) | Academic_Word_List_-_Sublist_1.pdf | 2023-11-15 10:12 | 217K | |
![[ ]](/icons/layout.gif) | Academic_Word_List.pdf | 2023-11-15 10:12 | 90K | |
![[ ]](/icons/layout.gif) | Academic Phrasebank Navigable PDF 2018 1.pdf | 2023-11-29 15:55 | 1.5M | |
![[ ]](/icons/layout.gif) | ARAB TILI o'quv-uslubiy majmua.pdf | 2023-10-31 11:48 | 2.2M | |
![[ ]](/icons/layout.gif) | 220203_6min_english_sleepy.pdf | 2023-11-15 09:55 | 147K | |
![[ ]](/icons/layout.gif) | 220127_6min_english_winter_olympics_prepartion.pdf | 2023-11-30 15:46 | 148K | |
![[ ]](/icons/layout.gif) | 5000 words in a month.pdf | 2023-11-21 11:03 | 24M | |
![[ ]](/icons/layout.gif) | 5000 word in a month.pdf | 2023-11-15 10:21 | 24M | |
![[ ]](/icons/layout.gif) | 5000_words_in_a_month.pdf | 2023-11-21 09:45 | 24M | |
![[ ]](/icons/layout.gif) | 4000 essential words 5.pdf | 2023-11-15 10:21 | 6.7M | |
![[ ]](/icons/layout.gif) | 4000 essential words 4.pdf | 2023-11-15 10:20 | 8.0M | |
![[ ]](/icons/layout.gif) | 4000 essential words 3.pdf | 2023-11-15 10:21 | 17M | |
![[ ]](/icons/layout.gif) | 4000 essential words 2.pdf | 2023-11-15 10:21 | 8.1M | |
![[ ]](/icons/layout.gif) | 4000 essential words 1.pdf | 2023-11-15 14:51 | 7.0M | |
![[ ]](/icons/layout.gif) | 4000 essential English words uzb.pdf | 2023-11-21 14:57 | 9.3M | |
![[ ]](/icons/layout.gif) | 4000 essential English words 1 uzb.pdf | 2023-11-29 16:00 | 9.3M | |
![[ ]](/icons/layout.gif) | 4000_academic_word_list.pdf | 2023-11-29 15:55 | 1.1M | |
![[ ]](/icons/layout.gif) | 4000_Essential_English_Words_2nd_ed_Book_1.pdf | 2023-11-21 11:03 | 29M | |
![[ ]](/icons/layout.gif) | 4000 Essential words 6.pdf | 2023-11-15 10:21 | 6.7M | |
![[ ]](/icons/layout.gif) | 4000 Essential English Words 6 (book).pdf | 2023-11-30 15:48 | 8.4M | |
![[ ]](/icons/layout.gif) | 4000 Essential English Words 5 (book).pdf | 2023-11-30 15:48 | 8.7M | |
![[ ]](/icons/layout.gif) | 4000 Essential English Words 4 (book).pdf | 2023-11-30 15:47 | 10M | |
![[ ]](/icons/layout.gif) | 4000 Essential English Words 3 (book).pdf | 2023-11-30 15:48 | 9.5M | |
![[ ]](/icons/layout.gif) | 4000 Essential English Words 2.pdf | 2023-10-31 12:53 | 9.1M | |
![[ ]](/icons/layout.gif) | 4000 Essential English Words 2 (book).pdf | 2023-11-30 15:48 | 9.1M | |
![[ ]](/icons/layout.gif) | 4000 Essential English Words 1 (book).pdf | 2023-11-30 15:48 | 9.3M | |
![[ ]](/icons/layout.gif) | 4000 Essential English.pdf | 2023-10-31 12:54 | 9.3M | |
![[ ]](/icons/layout.gif) | 4000-essential-english-words.pdf | 2023-11-06 10:09 | 7.0M | |
![[ ]](/icons/layout.gif) | 2700 words english-uzbek.pdf | 2023-11-30 18:07 | 858K | |
![[ ]](/icons/layout.gif) | 2700 words MurphyMrENGLISH.pdf | 2023-11-21 11:38 | 869K | |
![[ ]](/icons/layout.gif) | 2020_Book_LegalEducationAndLegalTraditio.pdf | 2023-11-10 16:49 | 1.4M | |
![[ ]](/icons/layout.gif) | 2000_ielts_words_band_8_and_band_7_ielts_vocabulary_in_25_to.pdf | 2023-11-29 15:51 | 1.5M | |
![[ ]](/icons/layout.gif) | 2000_ielts_words_band_8_and_band_7_ielts_vocabulary_in_25_to (2).pdf | 2023-11-29 15:51 | 1.5M | |
![[ ]](/icons/layout.gif) | 2000_ielts_words_band_8_and_band_7_ielts_vocabulary_in_25_to (1).pdf | 2023-11-29 15:51 | 1.5M | |
![[ ]](/icons/layout.gif) | 1800 Synonyms.pdf | 2023-11-29 16:00 | 8.4M | |
![[ ]](/icons/layout.gif) | 1200 most commonly used words in Listening.pdf | 2023-11-15 10:12 | 88K | |
![[ ]](/icons/layout.gif) | 1200_most_commonly_repeated_words.pdf | 2023-11-30 15:46 | 89K | |
![[ ]](/icons/layout.gif) | 1200 IELTS Listening Vocabulary.pdf | 2023-11-29 15:51 | 562K | |
![[ ]](/icons/layout.gif) | 1000_collocations_in10_minutes_a_day.pdf | 2023-11-21 09:45 | 1.3M | |
![[ ]](/icons/layout.gif) | 1000_English_Collocations.pdf | 2023-11-30 15:46 | 1.2M | |
![[ ]](/icons/layout.gif) | 1000 Quick Writing Ideas.pdf | 2023-11-28 17:25 | 1.7M | |
![[ ]](/icons/layout.gif) | 1000 English collocations a day.pdf | 2023-11-29 15:51 | 1.4M | |
![[ ]](/icons/layout.gif) | 1000 English Collocations. in 10 Minutes a Day.pdf | 2023-11-29 10:45 | 1.4M | |
![[ ]](/icons/layout.gif) | 1000 English Collocations. in 10 Minutes a Day .pdf | 2023-11-30 15:46 | 1.4M | |
![[ ]](/icons/layout.gif) | 1000 Collocations by Shayna.pdf | 2023-11-15 10:15 | 1.4M | |
![[ ]](/icons/layout.gif) | 600 sentences of spoken Chinese by Lanci.pdf | 2023-11-06 16:18 | 1.3M | |
![[ ]](/icons/layout.gif) | 501 Writing Prompts.pdf | 2023-11-28 17:24 | 450K | |
![[ ]](/icons/layout.gif) | 501-Synonyms-and-Antonyms.pdf | 2023-11-29 15:54 | 234K | |
![[ ]](/icons/layout.gif) | 330_English_Phrasal_Verbs_In_Use_M_McCarthy,_F_O'Dell_2004_208p.pdf | 2023-11-29 16:00 | 7.6M | |
![[ ]](/icons/layout.gif) | 300_Things_I_Hope_-_Iain_Thomas.pdf | 2023-11-15 09:55 | 6.2M | |
![[ ]](/icons/layout.gif) | 300 Essays (Makkar).pdf | 2023-11-30 15:46 | 11M | |
![[ ]](/icons/layout.gif) | 250+ IELTS topics solved.pdf | 2023-11-30 15:47 | 1.4M | |
![[ ]](/icons/layout.gif) | 240_Speaking_Topics.pdf | 2023-11-29 15:56 | 1.5M | |
![[ ]](/icons/layout.gif) | 230 IELTS Writing Samples.pdf | 2023-11-29 15:51 | 3.8M | |
![[ ]](/icons/layout.gif) | 220 IELTS Speaking Topics.pdf | 2023-11-29 16:06 | 90M | |
![[DIR]](/icons/folder.gif) | 202 useful exercises audio/ | 2024-01-03 12:35 | - | |
![[ ]](/icons/layout.gif) | 202-useful-Exercises-for-IELTS.pdf | 2023-11-28 17:24 | 1.4M | |
![[ ]](/icons/layout.gif) | 200 IELTS CUE CARDS.pdf | 2023-11-30 15:47 | 2.0M | |
![[ ]](/icons/layout.gif) | 179 IELTS Speaking Part 2 Samples.pdf | 2023-11-30 15:47 | 3.1M | |
![[ ]](/icons/layout.gif) | 169 IELTS Essay Samples.pdf | 2023-11-29 15:51 | 2.1M | |
![[ ]](/icons/layout.gif) | 160 Graphs (Makkar).pdf | 2023-11-30 15:47 | 9.9M | |
![[ ]](/icons/layout.gif) | 101 helpful hints for IELTS.pdf | 2023-11-29 15:51 | 1.2M | |
![[ ]](/icons/layout.gif) | 101_Essays_That_Will_Change_The_Way_You_Think_by_Brianna_Wiest_z.pdf | 2023-10-27 17:11 | 1.6M | |
![[ ]](/icons/layout.gif) | 101_American_English_Idioms.pdf | 2023-11-29 14:10 | 11M | |
![[ ]](/icons/layout.gif) | 100 ta ENG KO'P Ishlatiladigan fe'llar.pdf | 2023-11-29 15:54 | 80K | |
![[ ]](/icons/layout.gif) | 100 ielts cue cards.pdf | 2023-11-15 10:18 | 1.4M | |
![[ ]](/icons/layout.gif) | 100 Writing Mistakes.pdf | 2023-11-29 15:51 | 1.0M | |
![[ ]](/icons/layout.gif) | 100 Business Chinese Phrases & Expressions.pdf | 2023-11-06 16:18 | 834K | |
![[ ]](/icons/layout.gif) | 80 IELTS Listening Tests.pdf | 2023-11-29 15:58 | 2.5M | |
![[ ]](/icons/layout.gif) | 53. Barhudarov Language and translation.pdf | 2023-10-26 16:53 | 1.3M | |
![[ ]](/icons/layout.gif) | 51. Essentials of Linguistics.pdf | 2023-10-26 16:53 | 3.5M | |
![[ ]](/icons/layout.gif) | 50. Cognitive Linguistic Approaches to Teaching Vocabulary and Phraseology.pdf | 2023-10-26 16:53 | 3.8M | |
![[ ]](/icons/layout.gif) | 50-common-English-phrasal-verbs.pdf | 2023-11-28 17:23 | 666K | |
![[ ]](/icons/layout.gif) | 49. An Introduction to Language and Linguistics.pdf | 2023-10-26 16:53 | 9.7M | |
![[ ]](/icons/layout.gif) | 48. Master IELTS Visuals.pdf | 2023-10-26 16:53 | 3.8M | |
![[ ]](/icons/layout.gif) | 47. Complete IELTS Band 5-6.5 Workbook M.Harrison.pdf | 2023-10-26 16:53 | 6.9M | |
![[ ]](/icons/layout.gif) | 46. Complete IELTS bands 5-6.5 Student's book.pdf | 2023-10-26 16:53 | 83M | |
![[ ]](/icons/layout.gif) | 45. Bakoeva M. Muratova E., Ochilova M. English Literature.pdf | 2023-10-26 16:53 | 4.1M | |
![[ ]](/icons/layout.gif) | 44. English Literature from the_Rest J.E.Luebering.pdf | 2023-10-26 16:53 | 4.1M | |
![[ ]](/icons/layout.gif) | 44. Таржимонлик_мутахассислигига_кириш_2008_Ғофуров_И.pdf | 2023-10-26 16:53 | 1.7M | |
![[ ]](/icons/layout.gif) | 43. English Literature from the 19th J.E.Luebering.pdf | 2023-10-26 16:53 | 5.8M | |
![[ ]](/icons/layout.gif) | 42. Complete IELTS Bands 4-5 Student's Book.pdf | 2023-10-26 16:53 | 93M | |
![[ ]](/icons/layout.gif) | 41. Complete IELTS Bands 4-5 Teachers Book.pdf | 2023-10-26 16:53 | 14M | |
![[ ]](/icons/layout.gif) | 40 IELTS READING TESTS - PASSAGE 3 best.pdf | 2023-11-28 17:29 | 43M | |
![[ ]](/icons/layout.gif) | 40 IELTS READING TESTS - PASSAGE 2 best.pdf | 2023-11-28 17:29 | 40M | |
![[ ]](/icons/layout.gif) | 40 IELTS READING TESTS - PASSAGE 1 best.pdf | 2023-11-28 17:29 | 40M | |
![[ ]](/icons/layout.gif) | 40 IELTS Listening Tests - Section 2 (with answers).pdf | 2023-11-29 16:00 | 5.8M | |
![[ ]](/icons/layout.gif) | 40 IELTS Listening Tests - Section 1 (with answers).pdf | 2023-11-29 14:09 | 2.2M | |
![[ ]](/icons/layout.gif) | 32_ielts_essay_samples_band_9.pdf | 2023-11-29 15:51 | 728K | |
![[ ]](/icons/layout.gif) | 30_Days_To_A_More_Powerful_Vocabulary_by_Dr_Wilfred_Funk,_Norman.pdf | 2023-11-06 09:47 | 10M | |
![[ ]](/icons/layout.gif) | 30+Days+to+Better+Habits+Workbook.pdf | 2023-11-15 10:13 | 309K | |
![[ ]](/icons/layout.gif) | 24. Inter-cultural communication. A.Holliday.pdf | 2023-10-26 16:53 | 2.0M | |
![[ ]](/icons/layout.gif) | 21 Lessons for the 21st Century ( PDFDrive ).pdf | 2023-11-28 17:24 | 1.8M | |
![[ ]](/icons/layout.gif) | 21 Lessons for the 21st Century ( PDFDrive ) (1).pdf | 2023-11-28 17:24 | 1.8M | |
![[ ]](/icons/layout.gif) | 18. История арабских стран (Р.Г.Ланда).pdf | 2023-10-26 16:53 | 21M | |
![[ ]](/icons/layout.gif) | 16. uchebnik_arabskogo_jazyka.kuzjmin.pdf | 2023-10-26 16:53 | 16M | |
![[ ]](/icons/layout.gif) | 15 day s Practice for IELTS Reading.pdf | 2023-11-29 12:32 | 116M | |
![[ ]](/icons/layout.gif) | 15 Days Practice for IELTS Writing.pdf | 2023-11-29 12:30 | 26M | |
![[ ]](/icons/layout.gif) | 15 Days Practice for IELTS Speaking.pdf | 2023-11-29 12:32 | 54M | |
![[ ]](/icons/layout.gif) | 15 Days Practice for IELTS Reading.pdf | 2023-11-28 17:31 | 116M | |
![[ ]](/icons/layout.gif) | 15 Days’ Practice For IELTS Listening.pdf | 2023-11-30 15:46 | 18M | |
![[ ]](/icons/layout.gif) | 15 Arab tili darsligi (tarkib qoidalari bilan).pdf | 2023-11-28 17:25 | 5.7M | |
![[ ]](/icons/layout.gif) | 12. Skills for Effective Writing Level 4 SB.pdf | 2023-10-26 16:16 | 6.6M | |
![[ ]](/icons/layout.gif) | 11 Buronov_Ingliz tili grammatikasi_.pdf | 2023-11-21 11:03 | 19M | |
![[ ]](/icons/layout.gif) | 11. Effective Academic Writing Complete 2.pdf | 2023-10-26 16:16 | 38M | |
![[ ]](/icons/layout.gif) | 10. Effective Academic Writing Complete 1.pdf | 2023-10-26 16:15 | 34M | |
![[ ]](/icons/layout.gif) | 9 band score IELTS essays Task2.pdf | 2023-11-29 15:55 | 640K | |
![[ ]](/icons/layout.gif) | 9 band score IELTS essays Task1.pdf | 2023-11-30 15:46 | 1.8M | |
![[ ]](/icons/layout.gif) | 9. arab-tili-darslari.pdf | 2023-10-26 16:16 | 8.4M | |
![[ ]](/icons/layout.gif) | 9. Араб тили грамматикаси (V).pdf | 2023-10-26 16:16 | 1.7M | |
![[ ]](/icons/layout.gif) | 7. Arab hatotligi. A.Shoyunusov.pdf | 2023-10-26 16:16 | 33M | |
![[DIR]](/icons/folder.gif) | 6- Cambridge Certificate in Advanced English (CAE) 6/ | 2024-01-03 12:37 | - | |
![[DIR]](/icons/folder.gif) | 5- Cambridge Certificate in Advanced English (CAE) 5/ | 2024-01-03 12:37 | - | |
![[DIR]](/icons/folder.gif) | 4- Cambridge Certificate in Advanced English (CAE) 4/ | 2024-01-03 12:36 | - | |
![[ ]](/icons/layout.gif) | 3_hsk 4 voccabulary.pdf | 2023-11-06 16:18 | 1.5M | |
![[ ]](/icons/layout.gif) | 3. Academic skills.pdf | 2023-10-30 15:14 | 57M | |
![[ ]](/icons/layout.gif) | 3. Academic skills (1).pdf | 2023-10-27 17:13 | 57M | |
![[DIR]](/icons/folder.gif) | 2A_WB with WorkBook/ | 2024-01-03 12:35 | - | |
![[DIR]](/icons/folder.gif) | 2A_SB with WorkBook/ | 2024-01-03 12:35 | - | |
![[ ]](/icons/layout.gif) | 2. English Language Communication Skills.pdf | 2023-10-30 15:13 | 45M | |
![[ ]](/icons/layout.gif) | 2. English Language Communication Skills (1).pdf | 2023-10-30 15:14 | 45M | |
![[DIR]](/icons/folder.gif) | 2- Certificate in Advanced English & Audio CDS Level 2/ | 2024-01-03 12:35 | - | |
![[ ]](/icons/layout.gif) | 1_Improve_Your_Communication_Skills_Present_with_Confidence;_Write.pdf | 2023-10-30 15:08 | 1.8M | |
![[ ]](/icons/layout.gif) | 1_Improve_Your_Communication_Skills_Present_with_Confidence;_Write (1).pdf | 2023-10-27 17:12 | 1.8M | |
![[ ]](/icons/layout.gif) | 1_Cambridge_University_Press_English_Vocabulary_in_Use_Elementary.pdf | 2023-11-13 15:50 | 4.3M | |
![[ ]](/icons/layout.gif) | 1_600 sentences of spoken Chinese by Lanci.pdf | 2023-11-07 10:51 | 1.3M | |
![[ ]](/icons/layout.gif) | 1_词语 uzbekcha HSK5.pdf | 2023-11-06 17:32 | 1.6M | |
![[ ]](/icons/layout.gif) | 1 Oyda 5000 so'z English.pdf | 2023-11-30 15:46 | 24M | |
![[ ]](/icons/layout.gif) | 1. arab-tili-darslari. M.Xasanov.pdf | 2023-10-26 16:15 | 8.4M | |
![[DIR]](/icons/folder.gif) | 1- Certificate in Advanced English & Audio CDS Level 1/ | 2024-01-03 12:33 | - | |
![[ ]](/icons/layout.gif) | 1-37 Improve YI Reading Skills.pdf | 2023-11-28 17:24 | 12M | |
![[ ]](/icons/layout.gif) | 066_1_English_Collocations_In_Use.pdf | 2023-11-13 12:10 | 18M | |
![[ ]](/icons/layout.gif) | 高级口语-02.pdf | 2023-11-09 15:34 | 51M | |
![[ ]](/icons/layout.gif) | 高级写作-01.pdf | 2023-11-09 15:34 | 29M | |
![[ ]](/icons/layout.gif) | 词语 uzbekcha HSK5.pdf | 2023-11-07 10:51 | 1.1M | |
![[ ]](/icons/layout.gif) | 职业.pdf | 2023-11-08 13:46 | 1.1M | |
![[ ]](/icons/layout.gif) | 综合1.pdf | 2023-11-07 10:51 | 14M | |
![[ ]](/icons/layout.gif) | 看图说话 (下册).pdf | 2023-11-07 10:53 | 7.5M | |
![[ ]](/icons/layout.gif) | 看图说话 (上册).pdf | 2023-11-07 10:53 | 7.4M | |
![[ ]](/icons/layout.gif) | 汉语阅读教程_2_eng.pdf | 2023-11-07 10:55 | 40M | |
![[ ]](/icons/layout.gif) | 汉语阅读教程1_eng.pdf | 2023-11-07 10:55 | 35M | |
![[ ]](/icons/layout.gif) | 汉语语法.pdf | 2023-11-07 10:54 | 121M | |
![[ ]](/icons/layout.gif) | 汉语文化全景_中级汉语教程_上_Cultural_Panorama_Level_II.pdf | 2023-11-07 10:52 | 64M | |
![[ ]](/icons/layout.gif) | 汉语成语学习手册 .pdf | 2023-11-07 10:53 | 17M | |
![[ ]](/icons/layout.gif) | 汉语口语中级pdf.pdf | 2023-11-07 10:53 | 113M | |
![[ ]](/icons/layout.gif) | 新HSK1-9级词汇表.pdf | 2023-11-09 14:38 | 39M | |
![[ ]](/icons/layout.gif) | 新目标汉语5.pdf | 2023-11-09 15:22 | 35M | |
![[ ]](/icons/layout.gif) | 新目标汉语2.pdf | 2023-11-09 15:22 | 32M | |
![[ ]](/icons/layout.gif) | 报名HSK.pdf | 2023-11-06 17:22 | 733K | |
![[ ]](/icons/layout.gif) | 口语 6.pdf | 2023-11-09 15:22 | 43M | |
![[ ]](/icons/layout.gif) | 口语 4.pdf | 2023-11-09 15:22 | 27M | |
![[ ]](/icons/layout.gif) | 口语 3.pdf | 2023-11-09 15:22 | 29M | |
![[ ]](/icons/layout.gif) | 口语 1.pdf | 2023-11-09 15:22 | 35M | |
![[ ]](/icons/layout.gif) | 发展汉语高级口语(2)25元.pdf | 2023-11-09 15:22 | 41M | |
![[ ]](/icons/layout.gif) | 发展汉语 初级口语2 34元.pdf | 2023-11-09 14:32 | 52M | |
![[ ]](/icons/layout.gif) | 发展汉语中级口语(2)25元.pdf | 2023-11-09 14:32 | 21M | |
![[ ]](/icons/layout.gif) | 发展汉语中级口语(1)26元.pdf | 2023-11-09 14:32 | 28M | |
![[ ]](/icons/layout.gif) | 乖乖回家之路.pdf | 2023-11-08 14:05 | 1.1M | |
![[ ]](/icons/layout.gif) | 中国大学.pdf | 2023-11-07 11:29 | 2.9M | |
![[ ]](/icons/layout.gif) | интересные тексты.pdf | 2023-11-09 15:34 | 240K | |
![[ ]](/icons/unknown.gif) | инглиз тили.PDF | 2023-11-03 10:04 | 7.1M | |
![[ ]](/icons/unknown.gif) | инглиз тили фонетикаси.PDF | 2023-11-03 10:03 | 2.6M | |
![[ ]](/icons/layout.gif) | Хулиганский_английский_Заткнись_и_слушай.pdf | 2023-11-17 10:13 | 4.1M | |
![[ ]](/icons/layout.gif) | Хитой филологиясига кириш.pdf | 2023-10-26 16:15 | 25M | |
![[ ]](/icons/layout.gif) | Хитой тили тарихи.pdf | 2023-10-31 11:00 | 40M | |
![[ ]](/icons/layout.gif) | Филалогия_ва_маданият_масалалари.pdf | 2023-10-31 11:50 | 4.6M | |
![[ ]](/icons/layout.gif) | Учебник_арабского_языка_С_Кузмин.pdf | 2023-11-22 11:32 | 16M | |
![[ ]](/icons/layout.gif) | Учебник_арабского_языка.pdf | 2023-11-22 11:29 | 24M | |
![[ ]](/icons/layout.gif) | Учебник_Русский_язык_для_издания_19_10_2020_.pdf | 2023-11-02 11:17 | 11M | |
![[ ]](/icons/layout.gif) | Учебник_Русский_язык_для_издания_19_10_2020_ (2).pdf | 2023-11-02 11:18 | 11M | |
![[ ]](/icons/layout.gif) | Учебник арабского языка. С.Кузмин.pdf | 2023-10-26 16:16 | 16M | |
![[ ]](/icons/layout.gif) | Уроки_французского.pdf | 2023-10-27 17:11 | 166K | |
![[ ]](/icons/layout.gif) | Тил_ва_адабиёт_таьлимининг_долзарб_масалалари.pdf | 2023-10-31 11:51 | 14M | |
![[ ]](/icons/layout.gif) | Тилшунослик_асослари_фанидан_ўкув_кўлланма.pdf | 2023-11-27 15:48 | 6.0M | |
![[ ]](/icons/layout.gif) | Тилшуносликнинг_долзарб_масалалари.pdf | 2023-10-30 16:46 | 69M | |
![[ ]](/icons/layout.gif) | Таржима_назарияси_ва_амалиёти_Ғ_Раҳимов.pdf | 2023-11-22 10:01 | 2.4M | |
![[ ]](/icons/layout.gif) | Таржима_назарияси_асослари_2005_мусаев.pdf | 2023-11-22 11:27 | 12M | |
![[ ]](/icons/layout.gif) | Тайны Китайских иероглифов.pdf | 2023-10-26 16:16 | 1.7M | |
![[ ]](/icons/layout.gif) | Современная_лингвистика_в_свете_антропоцентризма_Нормурадова_Нозлия.pdf | 2023-10-30 16:46 | 70M | |
![[ ]](/icons/layout.gif) | Русско- арабский словарь.pdf | 2023-10-27 09:22 | 1.7M | |
![[ ]](/icons/layout.gif) | Русский язык 2019.pdf | 2023-11-03 11:53 | 100M | |
![[ ]](/icons/layout.gif) | Практический рукс Арабского литературного языка часть 2.pdf | 2023-11-22 11:29 | 16M | |
![[ ]](/icons/layout.gif) | Правила арабского языка в облегчённой и упрощённой форме (часть 1).pdf | 2023-10-26 16:53 | 1.9M | |
![[ ]](/icons/layout.gif) | Пособие_Основы_Менеджмента_Ф_Е_Удалов.pdf | 2023-11-22 11:32 | 3.5M | |
![[ ]](/icons/layout.gif) | Пособие по арабской грамматике (Амир Башир).pdf | 2023-10-26 16:53 | 3.3M | |
![[ ]](/icons/layout.gif) | Попова_И_Н_Французский_язык_Manuel_De_Francais_20_е_издание,_2009.pdf | 2023-11-16 16:43 | 72M | |
![[ ]](/icons/layout.gif) | О_Лингвистическом_Исследовании_Лакун_в_Условиях_Многоязычия.pdf | 2023-11-10 10:07 | 7.0M | |
![[ ]](/icons/layout.gif) | Основы психолингвистики и теории коммуникации (В.В.Красных).pdf | 2023-10-26 16:53 | 1.7M | |
![[ ]](/icons/layout.gif) | Основы психолингвистики и социолингвистики (Бабкина Е.С., Семенова И.В.).pdf | 2023-10-26 16:53 | 478K | |
![[ ]](/icons/layout.gif) | Организация_ЭВМ_и_систем_А_Чередов.pdf | 2023-11-22 11:32 | 3.6M | |
![[ ]](/icons/layout.gif) | Общая психология.pdf | 2023-10-26 16:53 | 3.4M | |
![[ ]](/icons/layout.gif) | Обучение_языкам_как_основа_развития_юридической_науки_и_образования.pdf | 2023-11-10 16:49 | 443K | |
![[ ]](/icons/layout.gif) | Началньный курс кореского языка.pdf | 2023-11-02 11:20 | 10M | |
![[ ]](/icons/layout.gif) | Лебедева вводный араб.pdf | 2023-11-22 11:29 | 19M | |
![[ ]](/icons/layout.gif) | Курс китайского языка 1-2 (rus).pdf | 2023-10-26 16:16 | 50M | |
![[ ]](/icons/layout.gif) | Корейский язык (средний уровен).pdf | 2023-11-02 11:20 | 35M | |
![[ ]](/icons/layout.gif) | Иброхимов, Юсупов Араб тили грамматикаси.pdf | 2023-11-22 11:27 | 1.6M | |
![[ ]](/icons/layout.gif) | Жон_Кехо,_Ненси_Фишер_Онг_қудрати.pdf | 2023-11-03 16:45 | 3.5M | |
![[ ]](/icons/layout.gif) | Глушенкова,_Комарова_Английский_язык_для_студентов_экономических.pdf | 2023-11-06 09:42 | 2.4M | |
![[ ]](/icons/layout.gif) | Бухгалтерия хисоби.pdf | 2023-11-22 17:43 | 26M | |
![[ ]](/icons/layout.gif) | Большой_англо_русский_и_русско_английский_словарь_Big_English_Russian.pdf | 2023-11-24 10:53 | 11M | |
![[ ]](/icons/layout.gif) | Бизнес-курс французского языка.pdf | 2023-11-16 16:43 | 13M | |
![[ ]](/icons/layout.gif) | Араб_тили_грамматикаси_1_жилд_Иброхимов_Н_Дарслик_2.pdf | 2023-11-22 11:29 | 15M | |
![[ ]](/icons/layout.gif) | Араб_тили_грамматикаси_1_жилд_Иброхимов_Н_Дарслик.pdf | 2023-11-22 11:27 | 15M | |
![[ ]](/icons/layout.gif) | Араб_тили_грамматикаси_1_жилд_Иброхимов_Н_Дарслик (1).pdf | 2023-11-22 11:27 | 15M | |
![[ ]](/icons/layout.gif) | Араб тили грамматикаси (IV).pdf | 2023-10-26 16:16 | 1.5M | |
![[ ]](/icons/layout.gif) | Араб тили грамматикаси (III).pdf | 2023-10-26 16:16 | 1.4M | |
![[ ]](/icons/layout.gif) | Араб тили грамматикаси (II).pdf | 2023-10-26 16:16 | 1.6M | |
![[ ]](/icons/layout.gif) | Араб тили грамматикаси (I).pdf | 2023-10-26 16:15 | 12M | |
![[ ]](/icons/layout.gif) | Арабский язык теория и технология перевода (Н.Д.Финкельбеог).pdf | 2023-10-26 16:53 | 15M | |
![[ ]](/icons/layout.gif) | Английский_для_студентов_факультетов_права_и_международных_отношений.pdf | 2023-10-30 11:56 | 24M | |
![[ ]](/icons/layout.gif) | Английский_быстро_и_легко_Экспресс_курс.pdf | 2023-11-24 10:54 | 4.7M | |
![[ ]](/icons/layout.gif) | Ўзбек_тилининг_изоҳли_фразеологик_луғати_by_Раҳматуллаев_Шавкат.pdf | 2023-10-30 11:56 | 16M | |
![[ ]](/icons/layout.gif) | Ёзув тарихи ва итобат санъати.pdf | 2023-03-30 16:25 | 44M | |
![[ ]](/icons/layout.gif) | Ёзув тарихи ва итобат санъати. S.G'aniyeva.pdf | 2023-10-26 16:16 | 44M | |
|